Wikipedia:
Coptisine
| Coptisine | |
|---|---|
 |
|
| IUPAC name | 6,7-Dihydro-bis(1,3)benzodioxolo(5,6-a:4',5'-g)quinolizinium |
| Identifiers | |
| CAS number | |
| PubChem | |
| SMILES | C1C[N+]2=C(C=C3C=CC4=C(C3=C2)OCO4)C5=CC6=C(C=C51)OCO6 |
| Properties | |
| Molecular formula | C19H14NO4+ |
| Molar mass | 320.319 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Coptisine is an alkaloid found in Chinese goldthread (Coptis chinensis). Famous for the bitter taste that it produces, it is served in Chinese herbal medicine along with the related compound berberine for treating digestive disorders caused by bacterial infections.
This entry is from Wikipedia, the leading user-contributed encyclopedia. It may not have been reviewed by professional editors (see full disclaimer)
