| Deoxyuridine | |
|---|---|
 |
|
| Identifiers | |
| CAS number | 951-78-0  |
| PubChem | 640 |
| MeSH | Deoxyuridine |
| SMILES |
C1C(C(OC1N2C=CC(=O)NC2=O)CO)O
|
| Properties | |
| Molecular formula | C9H12N2O5 |
| Molar mass | 228.202 |
| (what is this?) (verify) Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) |
|
| Infobox references | |
Deoxyuridine is a compound and a nucleoside. It is similar in chemical structure to uridine, but without the 2'-hydroxyl group.
Idoxuridine and Trifluridine are variants of deoxyuridine used as antiviral drugs. They are similar enough to be incorporated as part of DNA replication, but they possess side groups on the uracil component (an iodine and a CF3 group, respectively), that prevent base pairing.
|
|||||||||||||||||||||||||||
 |
This biochemistry article is a stub. You can help Wikipedia by expanding it. |
This entry is from Wikipedia, the leading user-contributed encyclopedia. It may not have been reviewed by professional editors (see full disclaimer)
