| EA-3148 | |
|---|---|
| IUPAC name |
O-cyclopentyl S-(2-diethylaminoethyl) methylphosphonothiolate
|
| Identifiers | |
| CAS number | 93240-66-5 |
| PubChem | 559673 |
| SMILES |
CCN(CC)CCSP(C)(=O)OC1CCCC1
|
| Properties | |
| Molecular formula | C12H26NO2PS |
| Molar mass | 279.378 g/mol |
| Density | 1.05 g/mL |
| Boiling point |
111.11 °C |
| Hazards | |
| Main hazards | Highly Toxic |
| NFPA 704 | |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
| Infobox references | |
EA-3148 (Substance 100A) is a "V-series" nerve agent related to the better-known compounds VX and VR.[1] It was studied by both the US and Soviet chemical weapons programmes during the Cold War, and is notable as the only nerve agent specifically identified in public domain sources as having a higher absolute potency as an acetylcholinesterase inhibitor than VX (around 50% more potent by weight).[2] However both the US and Soviet investigations of the compound concluded that despite its high potency, the physicochemical properties of the substance made it unsuitable for weaponisation, and further research was not conducted.[3] The chemical structure of EA-3148 falls within the scope of compounds designated "Toxic chemicals" under Schedule 1 of the Chemical Weapons Convention and so it is illegal throughout the world under international law and may only be used for certain types of scientific and medical research.
References
- ^ D Hank Ellison. Handbook of Chemical and Biological Warfare Agents (2nd) 2008. p28. ISBN 0849314348
- ^ Possible Long-Term Health Effects of Short-Term Exposure to Chemical Agents, Volume 1 (1982). Commission on Life Sciences. The National Academies Press. pp7,22,29,E3.
- ^ Vil S Mirzayanov. State Secrets. An Insider's Chronicle of the Russian Chemical Weapons Program. (2009) pp127-128. ISBN 9781432725662
|
||||||||||||||||||||
This entry is from Wikipedia, the leading user-contributed encyclopedia. It may not have been reviewed by professional editors (see full disclaimer)




