| Homovanillic acid | |
|---|---|
 |
|
| IUPAC name |
2-(4-Hydroxy-3-methoxy-phenyl)acetic acid
|
| Identifiers | |
| CAS number | 306-08-1  |
| PubChem | 1738 |
| MeSH | Homovanillic+acid |
| SMILES |
COC1=C(C=CC(=C1)CC(=O)O)O
|
| ChemSpider ID | 1675 |
| Properties | |
| Molecular formula | C9H10O4 |
| Molar mass | 182.173 |
| (what is this?) (verify) Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) |
|
| Infobox references | |
Homovanillic acid (HOC6H3(OCH3)CH2COOH; synonyms: 3-Methoxy-4-hydroxyphenyl acetic acid; HVA; 4-Hydroxy-3-methoxy-benzeneacetic acid; 4-Hydroxy-3-methoxyphenylacetic acid) is a major catecholamine metabolite. It is used as a reagent to detect oxidative enzymes, and is associated with dopamine levels in the brain.
In psychiatry and neuroscience, brain and cerebrospinal fluid levels of HVA are measured as a marker of metabolic stress caused by 2-deoxy-D-glucose.[1] HVA presence supports a diagnosis of neuroblastoma and malignant pheochromocytoma.
See also
References
- ^ Marcelis M, Suckling J, Hofman P, Woodruff P, Bullmore E, van Os J (September 2006). "Evidence that brain tissue volumes are associated with HVA reactivity to metabolic stress in schizophrenia". Schizophr. Res. 86 (1-3): 45–53. doi:. PMID 16806836. http://linkinghub.elsevier.com/retrieve/pii/S0920-9964(06)00225-8.
|
|||||||||||||||||||
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
This entry is from Wikipedia, the leading user-contributed encyclopedia. It may not have been reviewed by professional editors (see full disclaimer)
