| MPP+ | |
|---|---|
 |
|
| IUPAC name |
1-Methyl-4-phenylpyridin-1-ium
|
| Other names | Cyperquat |
| Identifiers | |
| CAS number | 39794-99-5 |
| PubChem | 39484 |
| EC number | 248-939-7 |
| MeSH | 1-Methyl-4-phenylpyridinium |
| SMILES |
C[n+]1=cc=c(c=c1)c2=cc=cc=c2
|
| Properties | |
| Molecular formula | C12H12N+ |
| Molar mass | 170.25 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
| Infobox references | |
MPP+ (1-methyl-4-phenylpyridinium) is a positively charged molecule with chemical formula C12H12N+. It is toxic and acts by interfering with oxidative phosphorylation in mitochondria, causing depletion of ATP and cell death.[1] It also inhibits the synthesis of catecholamines, reduces levels of dopamine and cardiac norepinephrine, and inactivates tyrosine hydroxylase.[1]
The neurotoxin MPTP is converted in the brain into MPP+ by the enzyme MAO-B, causing parkinsonism in primates by killing certain dopamine-producing neurons in the substantia nigra.
The chloride of MPP+ has been used as a herbicide under the trade name cyperquat and is structurally similar to the herbicide paraquat.
References
|
||||||||||||||||||||||||||||||||
This entry is from Wikipedia, the leading user-contributed encyclopedia. It may not have been reviewed by professional editors (see full disclaimer)
