 |
This article does not cite any references or sources. Please help improve this article by adding citations to reliable sources. Unsourced material may be challenged and removed. (March 2007) |
| Oxalosuccinic acid | |
|---|---|
 |
|
| IUPAC name |
1-Oxopropane-1,2,3-tricarboxylic acid
|
| Identifiers | |
| CAS number | 1948-82-9 |
| PubChem | 972 |
| SMILES |
C(C(C(=O)C(=O)O)C(=O)O)C(=O)O
|
| Properties | |
| Molecular formula | C6H6O7 |
| Molar mass | 190.11 g mol−1 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
| Infobox references | |
Oxalosuccinic acid is a substrate of the citric acid cycle. It is acted upon by isocitrate dehydrogenase. Salts and esters of oxalosuccinic acid are known as oxalosuccinates.
| Citric Acid Cycle Metabolic Pathway | ||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Oxaloacetate | Malate | Fumarate | Succinate | Succinyl-CoA | ||||||||||||
 |
 |
 |
 |
 |
||||||||||||
 |
 |
|
|
|||||||||||||
| Acetyl-CoA | NADH + H+ | NAD+ | H2O | FADH2 | FAD | CoA + ATP(GTP) | Pi + ADP(GDP) | |||||||||
 |
+ | H2O |  |
 |
NADH + H+ + CO2 | |||||||||||
| CoA | NAD+ | |||||||||||||||
 |
H2O |  |
H2O |  |
NAD(P)+ | NAD(P)H + H+ | |
CO2 |  |
|||||||
 |
 |
 |
|
|||||||||||||
| Citrate | cis-Aconitate | Isocitrate | Oxalosuccinate | α-Ketoglutarate | ||||||||||||
 |
This biochemistry article is a stub. You can help Wikipedia by expanding it. |
This entry is from Wikipedia, the leading user-contributed encyclopedia. It may not have been reviewed by professional editors (see full disclaimer)
