| Patchoulol | |
|---|---|
 |
|
 |
|
| IUPAC name |
3,4,4αβ,5,6β,7,8,8α-Octahydro-4α,8αβ,9,9-
tetramethyl-1,6-methanonaphthalen-1β(2H)-ol |
| Other names | Patchouli camphor; (–)-patchoulol; (1R,3R,6S,7S,8S)-patchoulol, patchouli alcohol |
| Identifiers | |
| CAS number | 5986-55-0 |
| EC number | 227-807-2 |
| SMILES |
O[C@@]23CC[C@@H]([C@@H]1C[C@@H](CC[C@@]12C)C3(C)C)C
|
| Properties | |
| Molecular formula | C15H26O |
| Molar mass | 222.36 |
| Appearance | Hexagonal-trapezohedral crystals |
| Density | 1.0284 |
| Melting point |
56 °C, 329 K, 133 °F |
| Boiling point |
140 °C, 413 K, 284 °F |
| Solubility in water | practically insoluble |
| Solubility in ethanol | soluble |
| Solubility in diethyl ether | soluble |
| Refractive index (nD) | 1.5029 |
| Hazards | |
| MSDS | External MSDS |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
| Infobox references | |
Patchoulol or patchouli alcohol (C15H26O) is a terpene extracted from Patchouli [1]. The (-)-optical isomer one of the organic compounds responsible for the typical patchouli scent.
Toxicology
 |
This section requires expansion. |
See also
- 10-hydroxypatchoulol
- Norpatchoulenol
External links
- ^ Deguerry F., Pastore L., Wu S., Clark A., Chappell J., Schalk M. The diverse sesquiterpene profile of patchouli, Pogostemon cablin, is correlated with a limited number of sesquiterpene synthases(2006) Archives of Biochemistry and Biophysics, 454 (2), pp. 123-136.
This entry is from Wikipedia, the leading user-contributed encyclopedia. It may not have been reviewed by professional editors (see full disclaimer)
