| Sulforhodamine B | |
|---|---|
 |
|
| IUPAC name |
2-(3-diethylamino-6-diethylazaniumylidene-xanthen-9-yl)-5-sulfo-benzenesulfonate
|
| Identifiers | |
| CAS number | 3520-42-1  |
| PubChem | 65191 |
| EC number | 220-025-2 |
| SMILES |
O=S(=O)(O)c4ccc(C=1c3c(OC=2C=1\C=C/C(=[N+](/CC)CC)/C=2)cc(cc3)N(CC)CC)c(c4)S([O-])(=O)=O
|
| InChI |
1/C27H30N2O7S2/c1-5-28(6-2)18-9-12-21-24(15-18)36-25-16-19(29(7-3)8-4)10-13-22(25)27(21)23-14-11-20(37(30,31)32)17-26(23)38(33,34)35/h9-17H,5-8H2,1-4H3,(H-,30,31,32,33,34,35)
|
| Properties | |
| Molecular formula | C27H30N2O7S2 |
| Molar mass | 558.666 g/mol |
| (what is this?) (verify) Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) |
|
| Infobox references | |
Sulforhodamine B or kiton red (C27H30N2O7S2) is a fluorescent dye with uses spanning from laser-induced fluorescence (LIF) to the quantification of cellular proteins of cultured cells. The red, solid, water-soluble dye is primarily used as a polar tracer.
The dye has maximal absorbance at 585 nm light and maximal fluorescence emission at 607 nm light. It does not exhibit pH dependent absorption or fluorescence over the range of 3 to 10.[1]
References
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
This entry is from Wikipedia, the leading user-contributed encyclopedia. It may not have been reviewed by professional editors (see full disclaimer)
