0
An example of dehydration synthesis would be two monosaccharide's joining together. For example, glucose and fructose. Another word for synthesis is combination.
Minerva Orn
Solon Zboncak
CaO + CO2 - CaCO3
Wiki User
∙ 13y agoAmmonia is synthesised for use as a fertilizer N2 + 3H2 = 2NH3
Dioctyl Maleate is synthesised for use in dispersants by reacting 2 ethyl hexyl alcohol with maleic anhydride
2 CH3CH(C2H5)CH2CH2CH2CH2OH + CH(CO)O(CO)CH = Dioctyl Maleate + H2O
MANAIA SAUNDERS TAUI...
A reportER writing about a series of related crimes
Wiki User
∙ 9y agoLaura asks some of her friends what they think of a new restaurant
Wiki User
∙ 9y agoSally asks her friends if she should see the movie they watched last night
or
Layton asks Mark and James which music they listen to.
Wiki User
∙ 13y agoA synthesis reaction is when 2 elements react to form 1 compound. For example, 2Ca + O2 -> 2CaO ; 2H2 + O2 -> 2H2O
Add your answer:
Earn +20 pts
What is enzyme synthesis?
the production of enzymes by activity including combining chemicals, which is the definition of synthesis.
A synthesis is the formation of bonds by removing water?
No, synthesis is the breaking of bonds that forms water, while dehydration synthesis is the breaking of bonds by removing water
What is tissue synthesis?
Tissue synthesis is toilet paper with a mind!
What is the site for protein-synthesis?
The site for protein synthesis is a cell structure. The specific structure in which synthesis occurs is the ribosomes, which is in the cytoplasm.
What is lipid synthesis?
Lipid synthesis is a process that makes and dissolves lipids. It consists of 2 phases fatty synthesis and lipid assembly.
Is an example of dehydration synthesis?
An example of dehydration synthesis would be two monosaccharide's joining together. For example, glucose and fructose. Another word for synthesis is combination.
What is a example of a synthesis reaction?
rust
What is an example of a synthesis?
CaO + CO2 - CaCO3
What equation is an example of a synthesis reaction?
Generally, a synthesis reaction is as follows; A + B > ABAn example of such is the synthesis of potassium chloride from potassium (solid) and chlorine gas: 2K + Cl2> 2KCl
Example of enzyme responsible for a synthesis of a substance?
phosphorylase
What is an example of synthesis reaction?
H2+Br2 2HBr
Is Williamson's synthesis an example of nucleophilic substitution rxn?
Williamson's synthesis an example of nucleophilic substitution rxn, in this rxn an alkyl halide is allowed to react with a Na alkokide.
What is the adjective for synthesis?
The adjective form for the noun synthesis is synthetic. Example use: Synthetic flowers don't need to be watered.
Which of these would be an example of a synthesis reaction?
H2+Br2--->2HBr
What equation is a example of a synthesis reaction?
CaO + CO2 - CaCO3
A chemical reaction in which two elements combine to form a compound is called a?
synthesis reaction
Glycogen glucose is an example of which pattern of chemical reaction?
synthesis reaction
