0
A non cyclic alkane always has a number of hydrogen atoms equal to 2c + 2, where c is the number of carbon atoms. Therefore, hexadecane, an alkane with 16 carbon atoms, will have 34 hydrogen atoms.
Wiki User
∙ 12y ago
Add your answer:
Earn +20 pts
How many atoms of carbon and hydrogen does decane have in it?
Decane has 10 carbon atoms and 22 hydrogen atoms.
How many Hydrogen atoms are there in C3H8?
How many hydrogen atoms are there in 3 molecules of C3H8?
How many hydrogen atoms are in an unbranched alkene with one double bond and 5 carbon atoms?
There are 10 hydrogen atoms in an unbranched alkene with 1 double bond and 5 Carbon atoms
How many hydrogen atoms can be attached to carbon A?
1
How many hydrogen atoms does cyclohexane have?
Since the chemical formula for Cycohexane is C6H12, it has 12 atoms of Hydrogen.
An alkane with 3 carbon atoms would have how many hydrogen atoms in the molecule?
The generic formula for an alkane is CnH(2n + 2).Therefore, an alkane with 3 carbon atoms would have 8 hydrogen atoms.
If an acyclic alkane hydrocarbon contains n carbon atoms how many hydrogen atoms must it also contain?
Then the acyclic alkane hydrocarbon contains 2n+2 hydrogen atoms.
How many carbons atoms would be present in an alkane that contains 32 hydrogen atoms?
In an alkane the number of hydrogen atoms is two greater than twice the number of carbon atoms. If we reverse this rule, we find that the number of carbon atoms is one less than half the number of hydrogen atoms. 32/2=16 16-1=15 So our alkane would have 15 carbon atoms. This alkane would be pentadecane or one of its isomers.
How many total hydrogen atoms would be in a five carbon noncyclical alkane?
Alkanes are CnH2n+2, so for 5 carbon alkane, n = 10+2 =12 or 12 hydrogen atoms. It would be like this..CH3CH2CH2CH2CH3
How many hydrogens are present on an alkane with 20 carbons?
An alkane with n carbon atoms has 2n + 2 hydrogen atoms.So, 42.
How many hydrogen atoms are present in 3-methyl-4-propyl-3-octene?
CH3CH2C(CH3)C(CH2CH2CH3)CH2CH2CH2CH3 24 hydrogen
How many hydrogen atoms are in an acyclic alkane with 13 carbon atoms?
28. Acyclic alkanes have the formula CnH(2n+2). If n is 13, 2n+2 is 28.
How many atoms of carbon and hydrogen does decane have in it?
Decane has 10 carbon atoms and 22 hydrogen atoms.
How many hydrogen atoms are there in an alkane molecule with 10 carbon atoms?
Formula for alkanes:Number of H = 2 * number of C + 2So, using this formula, H = 2 * 10 + 2, which gives 22
Determine How Many hydrogen atoms a compound has if its a hydrocarbon and its carbon atoms skeleton is c c-c c?
Hydrocarbon rule.2n + 2You have 4 carbons. I assume alkane.10 hydrogens.C4H10
What chemical series does methane belong to?
In chemistry, ethanol is a classified as an "alkane". It is also grouped as one of many "hydrocarbons", meaning it consists of only hydrogen and carbon atoms. It is also an "alcohol". I think ethane (alkane) and suffix of alcohol is how its name is derived.
How are carbon atoms and how many hydrogen atoms are in C2H6?
there are two Carbon Atoms and six Hydrogen atoms
