0
One atom, because Mono- means One
Wiki User
∙ 11y ago
Add your answer:
Earn +20 pts
How many atoms of sodium are represented by 6 Na?
6 Na means 6 atoms of Sodium 6 Na means 6 atoms of Sodium
How many sodium atoms make up the sodium element?
23 g of sodium metal will have 6.023 x 1023 atoms (or 1 mole of atoms)
How many atoms are there in 23g of sodium?
6.022x1023
How many atoms in sodium sulfide?
3
How many O atoms are present in sodium chlorite?
There are 2 oxygen atoms in 1 formula unit of sodium chlorite (NaClO2)
How many carbon atoms do MSG have?
Monosodium glutamate has 5 carbon atoms.
What is ajinomotto?
Ajino - moto is the flavouring used in many dishes. Mainly it is mono-sodium glutamate.
Why does Campbell's put mono sodium glutamate in their soup which causes weight gain?
Monosodium glutamate is put into many foods to preserve them longer.
Is MSG a drug?
No. MSG (monosodium glutamate) is a flavor enhancer used in many different types of foods.
What are the advantages of monosodium glutamate?
A flavouring enhancement substance added to food,used to improve the taste of many processed foods.
If glutamic acid has the formula HC5H8NO4 then what is the formula of sodium glutamate commonly known as MSG or monosodium glutamate?
MSG, 2-aminopentanedioic acid, is C5H8NNaO4 and has a SMILES (simplified molecular input line entry specification) of C(CC(=O)O)C(C(=O)O-)N.[Na+]. A link is provided to the Wikipedia article on MSG.
Asians consider this chemical to be the fifth taste sensation Many North Americans say that it gives them Chinese Restaurant Syndrome What is this chemical?
Monosodium glutamate
How many atoms of sodium are there in 0.200 moles sodium atoms?
0,2 mol sodium contain 1,204.10e23 atoms.
How many sodium atoms are in a molecule borax?
Borax has two sodium atoms.
What is the ordinary names of monosudiumglutamate?
Monosodium glutamate is used as a taste enhancer in the food industry, and comes under many chemical and trade names. It imparts a taste called "umami".
How many atoms atoms does sodium hydroxide have?
Sodium hydroxide is NaOH and contains three atoms, one each of sodium, hydrogen and oxygen.
How many sodium atoms are in a molecule of a borax?
Borax - Na2B4O7 - contain two sodium atoms.
