0
It is both!!!
FeSO4 can be separated into the ions Fe^(2+) and SO4^(2-)
That's the ionic bit.
For the sulphate anion (SO4^(2-)) the atoms are covelently bonded with in the ion. As best I can demonstrate S(=O)2 - (O^(2-))2 . That is two oxygens are doubly bonded to the sulphur and the other two oxygens are singly bonded to the sulphur, leaving each of these singly bonded atoms with a '2-' charge on them, for ionic combination.
lenpollock
Wiki User
∙ 8y agois ferrous sulphate ionic or covalent
Add your answer:
Earn +20 pts
Is zinc sulphate ionic or covalent bond?
ionic
Is barium sulphate covalent?
No, it is ionic.
Is ferrous sulfate covalent or ionic?
Ferrous sulfate is both ionic and covalent: The iron cations and polyatomic sulfate anions are ionically bonded, but the internal bonds within the sulfate anions are covalent.
Why is copper II sulphate an ionic or covalent bond?
Copper II Sulphate is an Covalent bonding because the charge is (+)ve
Is ferrous oxide a covalent or ionic?
Ionic. This is the best decription of FeO, iron(II) oxide.
Is zinc sulphate ionic or covalent bond?
ionic
Is barium sulphate covalent?
No, it is ionic.
Is ferrous sulfate covalent or ionic?
Ferrous sulfate is both ionic and covalent: The iron cations and polyatomic sulfate anions are ionically bonded, but the internal bonds within the sulfate anions are covalent.
Why is copper II sulphate an ionic or covalent bond?
Copper II Sulphate is an Covalent bonding because the charge is (+)ve
Is ferrous oxide ionic or covalent?
Ionic. This is the best decription of FeO, iron(II) oxide.
Is ferrous oxide a covalent or ionic?
Ionic. This is the best decription of FeO, iron(II) oxide.
Formula for ferrous sulphate?
The formula for ferrous sulphate is FeSO4.
What is ferrous sulphate molecular formula?
Ferrous sulphate, or iron (II) sulphate has the formula FeSO4.
What is color of Ferrous Sulphate?
Ferrous Sulphate, also known as Iron (II) sulphate or green vitrol is green.
What color if the ferrous sulphate is heated?
ferrous sulphate when it is heated it changes into red brown color
Is sodium laureth sulfate an ionic or covalent compound?
The chemical formula of sodium laureth sulfate is CH3(CH2)11(OCH2CH2)nOSO3Na.This compound is an anionic surfactant.
What colour is ferrous sulphate?
Ferrous sulfate is green in color
