0
Best Answer
CH3-CH=CH-CH2-CH3 + Br2 = CH3-CH(Br)-CH(Br)-CH2-CH3
Wiki User
∙ 14y agoThis answer is:
Add your answer:
Earn +20 ptsQ: The equation for the reaction between 2-pentene and bromine?
Write your answer...
Submit
Still have questions?
Continue Learning about Earth Science
What is equation for the reaction between silver and bromine?
you find yourself
What is the equation for the reaction between bromine and potassium chloride?
2KCl + Br2 ---> Cl2 + 2KBr
The equation for the single displacement reaction between bromine and calcium iodide?
Br2 + CaI2 → CaBr2 + I2
What is the equation reaction for cyclohexene bromine in dichloromethane?
sex
What is the balanced equation for a reaction between sodium bisulfite with bromine?
Br2 + 3NaHSO3 = 2NaBr + NaHSO4 + H2O + 2SO2
Related questions
What is the balanced chemical equation between neon and bromine?
Any reaction occur between neon and bromine.
What is equation for the reaction between silver and bromine?
you find yourself
What is the balanced chemical equation for the reaction that takes place between bromine iodide?
potassium
What is the equation for the reaction between bromine and potassium chloride?
2KCl + Br2 ---> Cl2 + 2KBr
The equation for the single displacement reaction between bromine and calcium iodide?
Br2 + CaI2 → CaBr2 + I2
What is the equation reaction for cyclohexene bromine in dichloromethane?
sex
What is the balanced equation for a reaction between sodium bisulfite with bromine?
Br2 + 3NaHSO3 = 2NaBr + NaHSO4 + H2O + 2SO2
What is the reaction between methane and bromine water?
It produces Bromomethane and Hydrogen Bromide Equation: CH4 + Br2 ----> CH3Br + HBr
Write an equation for the reaction between methane and bromine to make bromoethane and hydrogen bromide?
CH4 + Br2 --> CH3Br + HBr
What is the chemical equation for the reaction of ethylene and bromine water?
The chemical equation is:C2H4 + Br2 = C2H4Br2
What is the balanced equation of bromine and acetylene reaction?
The chemical reaction is:C2H2 + Br2 = CHBr=CHBr
Which equation has water as a product in the chemical reaction-?
bromine water? The reaction between hexene, bromine, and water is an addition reaction.
Copyright ©2024 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.