0
Any chemical reaction; a solution is obtained, containing ions as Na+ and the carboxy group -COOH.
Wiki User
∙ 11y ago
Add your answer:
Earn +20 pts
You sodium acetate a element a compound or a mixture?
Sodium Ethanoate (Acetate) is a COMPOUND. It is the sodium salt of ethanoic(acetic) acid. It formula is CH3COO^-Na^+
Sodium acetate and water chemical equation?
the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).
What is the calculation in finding the pH of a L solution to which has been added W ml of MM acetic acid and W ml of MM sodium acetate?
pH = pKa + log [sodium acetate]/[acetic acid] = Henderson Hasselbalch equation
What is sodium acetate made?
Sodium acetate is obtained from the reaction of the acetic acid with sodium hydroxide, sodium carbonate, etc.
What is the reaction between acetyl chloride and sodium acetate?
acetic anhydride and sodium chloride will form.
What do you mix with Sodium Bicarbonate to make Sodium Acetate?
Acetic acid
What is CH3COOAg?
CH3COO4- (C2H3O5-) is the chemical formula of the 2-hydroperoxy-2-hydroxy-acetate anion. Of course if the 4 was a typo for H it would be acetic acid. If there are brackets (CH3COO)4 its the tetracacetate portion of the formula of a salt such as lead(IV) acetate.
What is the formula of the solid reactant of sodium carbonate and acetic acid?
Sodium carbonate is a solid reactant. It will form sodium acetate and carbon dioxide with acetic acid. The formual for the solid product sodium acetate is CH3COONa.
What is the compound name of NaC2H3O2?
sodium acetateThe chemical name for NaC2H3O2 is sodium acetate.
What is CH3OONa?
Sodium acetate - the conjugate base to acetic acid
Why pH of sodium acetate is always adjusted with glacial acetic acid only?
in order to form acetate/acetic acid buffer solution!
What happens when sodium hydroxide is added to acetic acid?
sodium acetate and water are formed.
