The position of double bond is different. CH3-CH=CH-CH2-CH2-CH3 is 2-hexene CH3-CH2-CH=CH-CH2-CH3 is 3-hexene
difference between activator and inhibitor
What is the difference between electroplating and galvanising
what is difference between exhaustible and inexhaustible
Difference between bleach and WHAT
Difference between biosynthesis and synthesis
A semi-structural formula for this molecule is CH3-(CH2)2-CH=C(CH3)-CH3.
difference between as on and as at
What is the difference between Florida and California What is the difference between Florida and California
what's the difference between physician and doctorwhat's the difference between physician and doctor what's the difference between physician and doctor
Difference between paging and what?
difference between enterprise and corporation
The difference between a shogun and a samurai is like the difference between a king and a knight.
difference between enterprise and corporation
just difference
Difference between it and what?
what is the main difference between polyethylene and polyesters what is the main difference between polyethylene and polyesters
The difference between Disneyland and Disneyworld is that Disneyland is in California and Florida is in Disneyworld. This is the difference between Disneyland and Disneyworld.