Tags Chemistry

Animals & Plants Arts & Entertainment Auto Beauty & Health Books and Literature Business Electronics Engineering & Technology Food & Drink History Hobbies Jobs & Education Law & Government Math People & Society Science Social Studies Sports Travel & Places

0

Subjects>Science>Chemistry

What is the condensed structural formula for ethyne?

Updated: 8/9/2023

Wiki User

∙ 12y ago

Best Answer

the formula for the compound is C2H2

to express this in its simplest form devide each atom be a common number, here we can see that there is 2 of each atom so an emperical formula would be CH

Wiki User

∙ 14y ago

This answer is:

More answers

Wiki User

∙ 13y ago

the condensed formula is C6H5CH2CH3

the molecular formula is C8H10

This answer is:

Wiki User

∙ 12y ago

CHCH

This answer is:

Wiki User

∙ 10y ago

Ch2=Ch2

This answer is:

Add your answer:

Earn +20 pts

Q: What is the condensed structural formula for ethyne?

Write your answer...

Submit

Still have questions?

imp

Continue Learning about Chemistry

Draw the condensed structural formula for 3-decyne?

Ch3ch2ch2ch2ch2ch2c=-cch2ch3

Condensed structural formula of methyl propyl ether?

Ch3-o-c3h7

What is the condensed structural formula of hexyl acetate?

Ch3c(=o)(-o-)ch2ch2ch2ch2ch2ch3

What is the condensed structural formula of butyl propyl amine?

CH3CH2CH2CH2NHCH2CH2CH3

What is the condensed formula for 223trimethylpentane?

2,2,3- trimethyl pentane has the structural shape. CH3-C(CH3)2-CH(CH3)-CH2-CH3 C8H18 is the condensed /reduced formula.

Related questions

What is the condensed structural formula of cyclohexane?

Cyclohexane which is a cycloalkanes, has a structural formula of C6H12. It may be written in a condensed form as (CH2)6.

How does a complete structural formula differ from condensed formula?

The complete or full structural formula shows all the atoms and their bonds separately. The condensed structural formula shows the atoms present but does not show the bonds.

How does a complete structural formula differ from a condensed structural formula?

------ The condensed structural formula is simply a shortened version of the complete structural formula. -------The complete formula indicates all of the carbon and hydrogen atoms. The condenced formula groups the hydrogen atoms with each of the carbon atoms.

What is the difference between structural and condensed formula?

The structural formula show the position of atoms in a molecule.

What is the condensed structural formula of pentyl acetate?

CH3COOCH2CH2CH2CH2CH3

What is the condensed structural formula for 1-pentene?

Ch3ch3ch3hch3

What is the condensed structural formula for 4-bromo-2-pentanone?

The formula is C5H9BrO.

Draw the condensed structural formula for 3-decyne?

Ch3ch2ch2ch2ch2ch2c=-cch2ch3

What is the condensed structural formula for 2 4-Dimethylphenol?

The chemical formula of 2,4-dimethylphenol is C8H10O.

What is the condensed structural formula for methyl acetate?

H3c-c(=o)(-och3)

What is the the condensed structural formula of the compound propene?

Ch2chch3 c=c-c

What is the condensed structural formula of butyl propyl amine?

CH3CH2CH2CH2NHCH2CH2CH3

Trending Questions

Why you cant coat iron on gold? If a necklace is stamped '925' and also stamped 'Italy' is it real silver? What is the molarity of 2 moles of a compound dissolved in 4 L water? What is proximate and ultimate analysis of coal? What are the differences between potassium and iron? Why is too much nitrogen harmful to your water supply? Why is Ammonium hydroxide used in window cleaners? Does more salt in water cause more rust on steel? What are some items that are made out of nitrogen? What causes welding spatter? What is more important for life oxygen or food? What are the two indirect method of titration? What is the reason for the deep yellow colour of the dibenzalacetone? When we say an ion or a molecule is a base we mean that it has a tendency to? What did Lavoisier do to help Einstein? What forces in carbon 14 does isotope transform a neutron into a proton? How many oxygen atoms are in a formula unit of sodium acetate? How many carbon dioxide molecules are there in 3.74 moles of carbon dioxide? What type of bond is helium and fluorine? How do you get wrinkles out of a plastic tablecloth after washing?

Still have questions?

imp

Previously Viewed

What is the condensed structural formula for ethyne?

Resources

Top Categories

Product

Company

Copyright ©2024 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.