0
What is the molecular shape for ch2 double bond c double bond ch2?
Wiki User
∙ 11y ago
h
| h-c=o
Wiki User
∙ 11y ago
Add your answer:
Earn +20 pts
What is the full structural formula for CH2-CH2 in ethylene?
The structural formula is best displayed as a diagram, similar to H_ ..... _H H_C=C_H or (CH2)(CH2) In C2H4 (ethane, ethene, ethylene) there is a double carbon bond between CH2 structures.
Why is it called 3-heptene?
3-heptene indicates that the third carbon atom in the seven-carbon chain has a double bond with the fourth carbon atom. H3C-CH2-CH=CH-CH2-CH2-CH3
What is a hydro carbon with double bonds?
An alkene has a double bond between its carbon atomsE.g H2C=CH2 This is an ethene molecule, the simplest of alkenes.
What is the Structure of hexanal?
The structural formula of hexane isCH3(CH2)4CH3For skeletal and other graphical representations, seehttp://en.wikipedia.org/wiki/HexaneC6H12 It is an alkane ,a hydrocarbon
What is Molecular mass of CH3(CH2)11(OCH2CH2)nOSO3Na?
What is mol mass of CH3(CH2)11(OCH2CH2)nOSO3Na
Does styrene have a double bond?
C6H5CH=CH2. yes
What is a doble bond?
A double bond is a covalent bond where 4 electrons are shared as in H2C=CH2
Ethyl butyrate structural formula?
H_ ..... _H H_C=C_H In C2H4 (ethane, ethene, ethylene) there is a double carbon bond between CH2 structures.
What is name of ch2 double bond o?
Formaldehyde, or methanal
What is the of 4 4?
4-methyl-4-nonene CH3-CH2-CH2-CH(CH3)=CH-CH2-CH2-CH2-CH3 The (CH3) is a methyl group stemming from the CH just before it (#4). - single bond = double bond.
What is the nomenclature name for ch3-ch2-chch-ch2-ch2-ch2-ch3?
oct-3-ene (IUPAC)8 carbonsone double-bond on the third carbonno branches
What is the structure of 4-methyl-4-nonene?
4-methyl-4-nonene CH3-CH2-CH2-CH(CH3)=CH-CH2-CH2-CH2-CH3 The (CH3) is a methyl group stemming from the CH just before it (#4). - single bond = double bond.
What is the condensed structure for Camphor?
there are 4 possibilities 1- CH3-CH2-C=CH one triple bond 2-CH3-C=C-CH3 one triple bond 3-CH2=CH-CH=CH2 two double bonds 4-CH2=C=CH-CH3 two double bonds
What is the structural formula for trans-2-heptene?
CH3-CH=CH-CH2-CH2-CH2-CH3 if hydrogen of doble bonded carbons are at the same side of plane of double bond then it is cis isomer....
Why is no number used in the names ethene and propene?
ethene: CH2=Ch2 propene: CH2=CH3CH There is nowhere else to place a double bond! (C=C) No number is used in the names ethene and propene because the number would be useless as the double bond is located at carbon "1"
What is the full structural formula for CH2-CH2 in ethylene?
The structural formula is best displayed as a diagram, similar to H_ ..... _H H_C=C_H or (CH2)(CH2) In C2H4 (ethane, ethene, ethylene) there is a double carbon bond between CH2 structures.
How do you draw 3-ethylhexanoic acid in line-bond form?
CH3-CH2-CH2-C(CH2-CH3)-CH2-C double bonded to O & single bonded to O-H to form a carboxylic acid
