0
sodium acetate = Na+C2H3O2- (a salt)
nitric acid = HNO3
equation:
NaC2H3O2 + HNO3 --> NaNO3 + C2H4O2
Wiki User
∙ 14y ago
Wiki User
∙ 10y agoNo reaction
Add your answer:
Earn +20 pts
What is the balance equation of Sodium Nitrate and Potassium Chloride?
s + p =
What is the net ionic equation of potassium chloride and sodium nitrate?
There is none because they cancel out.
Is sodium acetate flammable?
Yes, under the right conditions, sodium acetate is flammable. In fact, a mixture of sodium acetate and potassium nitrate, when intimately mixed, and heated, will explode -- sodium acetate is incompatible with strong oxidizers. The reaction is said to be about "one third as powerful" as that between potassium nitrate, potassium carbonate, and sulfur (in a 3:2:1 ratio -- "yellow powder") under the same conditions of slow heating. Do not try this at home (but, if you must, stick to quantities of a gram or less, and use hearing and eye protection, and keep away from anything flammable).
Equation of silver nitrate in photography?
When making photographic film, silver nitrate is treated with halide salts of sodium or potassium to form insoluble silver halide in situ in photographic gelatin, which is then applied to strips of tri-acetate or polyester. AgNO3 + NaCl -------->AgCl(s) + NaNO3 .
What is the equation of magnesium nitrate with an excess of sodium phosphate to make sodium nitrate and magnesium phosphate.?
no reaction
What is the balance equation of Sodium Nitrate and Potassium Chloride?
s + p =
What is the skeleton equation for sodium nitrate plus potassium chloride?
NaNO + Kcl =Nacl + KNO3 Further answer But the formula for sodium nitrate is NaNO3, not NaNO.
What is the net ionic equation of potassium chloride and sodium nitrate?
There is none because they cancel out.
What is the molecular equation for potassium chloride and sodium nitrate?
KCl + NaNO3 ----> KNO3 + NaCl
Is sodium acetate flammable?
Yes, under the right conditions, sodium acetate is flammable. In fact, a mixture of sodium acetate and potassium nitrate, when intimately mixed, and heated, will explode -- sodium acetate is incompatible with strong oxidizers. The reaction is said to be about "one third as powerful" as that between potassium nitrate, potassium carbonate, and sulfur (in a 3:2:1 ratio -- "yellow powder") under the same conditions of slow heating. Do not try this at home (but, if you must, stick to quantities of a gram or less, and use hearing and eye protection, and keep away from anything flammable).
What is the ionic equation of NaCl aq plus KNO3 aq?
Do you mean: Na+Cl- + K+N03- --------> K+Cl- + Na+NO3- Sodium + Potassium ---> Potassium + Sodium Chloride Nitrate Chloride Nitrate
Equation of silver nitrate in photography?
When making photographic film, silver nitrate is treated with halide salts of sodium or potassium to form insoluble silver halide in situ in photographic gelatin, which is then applied to strips of tri-acetate or polyester. AgNO3 + NaCl -------->AgCl(s) + NaNO3 .
What is the name of another salt?
Examples: uranyl nitrate, sodium acetate, potassium chloride, lithium bromide, iron sulfide, copper sulfate etc.
What is the equation for sodium chloride and sodium nitrate?
Sodium chloride and and sodium nitrate doesn't react.
What is the equation for sodium acetate?
C2H3NaOO
Sodium acetate and water chemical equation?
the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).
Equation for sodium chloride with mercurous nitrate?
Im not quite sure, but since potassium chloride and ammonium nitrate forms kno3, theoretically, sodium chloride and ammonium nitrate would form sodium nitrate. (Im not 100% sure due to that sodium chloride is more soluble than potassium chloride.)
