0
Butane means the molecule has 4 carbon atoms.
Iso means one of those carbons is a side chain.
The resulting molecule is something with a tetraeder shape, a carbon atom at the center with one hydrogen side "chain" and three CH3 side chains. (remember a carbon can make a total of 4 bonds. The formula for isobutane is therefore CH(CH3)3 or C4H10 for a grand total of 10 hydrogen atoms.
Wiki User
∙ 9y ago
Wiki User
∙ 11y agoA molecule of butene contains 8 hydrogen atoms.
Wiki User
∙ 7y agoA molecule of 1-butyne contain six atoms of hydrogen (CH3CH2CCH).
Wiki User
∙ 13y agoButane is C4H10 and so there are 10.
Wiki User
∙ 12y ago4
Wiki User
∙ 12y ago4
Wiki User
∙ 11y ago10
Add your answer:
Earn +20 pts
How many carbon atoms are in isobutane?
There are four carbon atoms in a molecule of isobutane.
How many hydrogen atoms are present in the molecule 2 5 dimethyloctane?
This molecule contains 22 hydrogen atoms.
How many hydrogen atom are present in H2 SO 4?
2 hydrogen atoms
How many hydrogen atoms are present in 3-methyl-4-propyl-3-octene?
CH3CH2C(CH3)C(CH2CH2CH3)CH2CH2CH2CH3 24 hydrogen
How many hydrogen atoms does caffeine has?
To answer your question on how many hydrogen atoms are there in caffeine, the scientific answer would be 10 atoms of hydrogen.
How many carbon atoms are in isobutane?
There are four carbon atoms in a molecule of isobutane.
How many hydrogen atoms are present in a water molecule?
there are 2 atoms of hydrogen in water
How many hydrogen atoms are present i H2SOn4?
1 Hydrogen atom is present in H2SOn4.
How many atoms in a particle does hydrogen have?
Hydrogen exists as H2 which is a molecule. There are thus two atoms present.
How many atoms of hydrogen are present in the present in the reactants and in the products?
2
How many hydrogen atoms are present in 2.00mg of aspartame?
The amount of hydrogen atoms that are present in 2.00 mg of aspartame are 2.167*10^22.
How many hydrogen atoms are present in 4C2H5OH?
24
How many molecules are present in a molecule of hydrogen?
there are 2 atoms of hydrogen in water
How many hydrogen atoms are present in the molecule 2 5 dimethyloctane?
This molecule contains 22 hydrogen atoms.
How many hydrogen in a chemical formula?
The number of hydrogen atoms of present in a hydrogen molecule are 2.
How many hydrogen atom are present in H2 SO 4?
2 hydrogen atoms
How many atoms of hydrogen are present in nh3 molecule?
2
