0
CH3-CH2-CH(CH3)-CH(Cl)-CH2-CH3
Wiki User
∙ 13y ago
Add your answer:
Earn +20 pts
What are the possible isomers of chlorohexane?
I can only think of 14 of them, but i know there are a few more 1-chlorohexane 2-chlorohexane 3-chlorohexane 1-chloro-2-methylpentane 1-chloro-3-methylpentane 1-chloro-4-methylpentane 2-chloro-3-methylpentane 2-chloro-4-methylpentane 3-chloro-2-methylpentane 1-chloro-2,2-dimethylbutane 3-chloro-2,2-dimethylbutane 1-chloro-3,3-dimethylbutane 1-chloro-2,3-dimethylbutane 2-chloro-2,3-dimethylbutane
Why are substitutions at 4' and 6' positions of 3-chloro toluene not normally possible?
Substitutions at 4' and 6' positions of 3-chloro toluene are not normally possible because carbocations are prone to rearrangement.
How do you draw the structure 5-chloro-3-ethyl-4-methyloctane?
To begin with, octane is a chain of 8 carbons. If you were to draw these eight carbons in a row and number them 1-8, then the numbers corresponding to the substituents (chloro, ethyl and methyl) will show you where to put them. Off of the fifth carbon from one end (make sure you are consistent with which end you use!) is Cl Off of the third carbon is the ethyl group (CH2-CH3) and off of the fourth is the methyl group (CH3)
Is 4-methylcyclohexanol solubility in hexane?
yes
How do you make 5-chloro methopabate?
This compound is used as derivative of a coccidiostat in poultry farming.It should not be made at home.5-chloro 4-(acetylamino)2-methoxy methylbenzoate2(CH3O-)4(CH3CONH-)-5(Cl-)C6H5COO(CH3) (chemical compound))
What are the possible isomers of chlorohexane?
I can only think of 14 of them, but i know there are a few more 1-chlorohexane 2-chlorohexane 3-chlorohexane 1-chloro-2-methylpentane 1-chloro-3-methylpentane 1-chloro-4-methylpentane 2-chloro-3-methylpentane 2-chloro-4-methylpentane 3-chloro-2-methylpentane 1-chloro-2,2-dimethylbutane 3-chloro-2,2-dimethylbutane 1-chloro-3,3-dimethylbutane 1-chloro-2,3-dimethylbutane 2-chloro-2,3-dimethylbutane
What is the name of the chemical which has 7 carbon atoms and 16 hydrogen atoms?
The simplest one is the ALKANE , Heptane. (C7H16) CH3CH2CH2CH2CH2CH2CH3 It has numerous isomers. 2-methyl-hexane , 3-methyl-hexane, 4-methyl-hexane 3-ethyl-pentane. 1-methlycyclohexane 1-ethylcyclopentane, 1,2-dimethyl-cyclopentane, 1,3-dimethyl-cyclopentane 1,2,3-trimethylcyclobutane, 1-ethyl-2-methylcyclobutane. 1,2,-dimethyl-3-ethyl-cyclopropane, NB The cyclobutanes and cyclopropanes are unstable, because of the strained ring structure.
How do you write structure of 3-ethyl-4-methylhexane?
C-C-C-C-C-C hexane 3rd C gets a CH2CH3 for ethyl 4th C gets a CH3 for methyl
Why are substitutions at 4' and 6' positions of 3-chloro toluene not normally possible?
Substitutions at 4' and 6' positions of 3-chloro toluene are not normally possible because carbocations are prone to rearrangement.
How do you draw the structure 5-chloro-3-ethyl-4-methyloctane?
To begin with, octane is a chain of 8 carbons. If you were to draw these eight carbons in a row and number them 1-8, then the numbers corresponding to the substituents (chloro, ethyl and methyl) will show you where to put them. Off of the fifth carbon from one end (make sure you are consistent with which end you use!) is Cl Off of the third carbon is the ethyl group (CH2-CH3) and off of the fourth is the methyl group (CH3)
What is 4-chloro?
Halodrol
What is the IUPAC name of cresol?
o Cresol 2-methyl phenol m Cresol 3-methyl phenol p- Cresol 4- methyl phenol
Does 3-chloro-3-methylhexane have optical isomers?
Yes. 4 different groups are bonded to the third carbon atom.
How many isomers does heptyne have?
14 1-heptyne 2-heptyne 3-heptyne 3-methyl-1-hexyne 4-methyl-1-hexyne 5-methyl-1-hexyne 4-methyl-2-hexyne 5-methyl-2-hexyne 2-methyl-3-hexyne 3,3-dimethyl-1-pentyne 4,4-dimethyl-1-pentyne 3-ethyl-1-pentyne 3,4-dimethyl-1-pentyne 2,2-dimethyl-3-pentyne
Is 4-methylcyclohexanol solubility in hexane?
yes
Four isomers of dichloropropane?
The four isomers of the compound dichloropropane are 1,1-dichloropropane, 1,2-dichloropropane, 1,3-dichloropropane and 2,2-dichloropropane. The chemical formula for dichloropropane is C3H6Cl2.
What is the mechanism for the nitration of 4 methylphenol nitric acid with sulfuric acid catalyst?
4 methyl (3, 5 dinitro) phenylol
