0
no
Wiki User
∙ 9y ago
Add your answer:
Earn +20 pts
Pentane Methane Propane Octane Which of these chemical formulas represents the formula for C3H8?
propane
What are some examples of things that aren't solvents?
pentane, hexane, benzene, toluene, and octane
The uses for the first 10 alkanes?
1. Methane 2. Ethane 3. Propane 4. Butane 5. Pentane 6. Hexane 7. Heptane 8. Octane 9. Nonane 10. Decane
What is petrols melting point?
Because gasoline is a mixture of many different hydrocarbons from hexane to dodecane, there is no set melting point. The melting point for octane is about -57 degrees Celsius, and the melting point for heptane is -91 degrees Celsius.
Which mixture would be easier to separate by distillation a mixture of pentane and octane or a mixture of pentane and a branched-chain octane isomer Explain your reasoning?
hexane and octane is easier to separate than hexane and heptane because the difference in their boiling points is greater thus hexane will distill out of solution more completely before octane
Do cars burn pentane or octane?
Mostly octane.
Octane has a higher boiling point than pentane because?
Octane has a higher boiling point than pentane because octane has a larger number of carbon atoms than propane
What are non examples of polarity?
pentane, hexane, benzene, toluene, and octane
What is the common name for octane?
The molecular formula of octane is C8H18. It doesn't really have a "symbol."The "octane" in gasoline is actually "iso-octane" or 2,2,4-trimethylpentane. It has the same molecular formula, but the atoms are arranged differently than in n-octane.
Pentane Methane Propane Octane Which of these chemical formulas represents the formula for C3H8?
propane
What organic compound contains 5 hydrocarbons and 2 hydroxyl groups?
Pentane 1,5 diol pentane 1,4 diol pentane 2,4 diol pentane 2,3 diol Neopentyl glycol
What is octane?
Octane is an alkane hydrocarbon with the chemical formula C8H18.
What are some examples of things that aren't solvents?
pentane, hexane, benzene, toluene, and octane
Is octane inorganic?
it is organic
What is the condensed formula for 223trimethylpentane?
2,2,3- trimethyl pentane has the structural shape. CH3-C(CH3)2-CH(CH3)-CH2-CH3 C8H18 is the condensed /reduced formula.
The uses for the first 10 alkanes?
1. Methane 2. Ethane 3. Propane 4. Butane 5. Pentane 6. Hexane 7. Heptane 8. Octane 9. Nonane 10. Decane
Does pentane react with bromine water?
When it burns, pentane's reaction is to form carbon dioxide and water. However, at room temperature pentane, which is an alkane, is unreactive.
