0

Subjects>Science>Natural Sciences

Is ratio-oxycocet 5-325mg stronger thanlenoltec no3?

Anonymous

∙ 13y ago

Updated: 6/25/2024

Ratio-Oxycocet 5-325mg is stronger than Lenoltec No.3 because it contains oxycodone, which is a stronger opioid pain medication compared to codeine in Lenoltec No.3. Oxycodone is typically more potent and effective in managing moderate to severe pain.

AnswerBot

∙ 1y ago

What else can I help you with?

Continue Learning about Natural Sciences

How many single bonds in NO3?

(NO3)- has three single bonds.

What is the formula for the salt which contains both Ca and NO3 ions?

The formula for the salt containing both Ca and NO3 ions would be Ca(NO3)2. This is because calcium (Ca) has a 2+ charge and nitrate (NO3) has a 1- charge, so to balance the charges, you need two NO3 ions for each Ca ion.

What is the formula for the ionic compounds formed by magnesium ions and calcium ions with nitrate ions?

The formula for the ionic compound formed by magnesium ions (Mg2+) and nitrate ions (NO3-) is Mg(NO3)2. The formula for the ionic compound formed by calcium ions (Ca2+) and nitrate ions (NO3-) is Ca(NO3)2.

When Al(NO3)3 is separated into its ions how is it written?

Al(NO3)3(aq) ===> Al^3+(aq) + 3NO3^-(aq) is how aluminum nitrate ionizes in aqueous media.

What is the empirical formula and name for the compound for Co NO3 2?

The empirical formula for Co(NO3)2 is Co(NO3)2. The compound is named cobalt(II) nitrate.

Related Questions

Which one is stronger base CN or NO3?

CN- is a stronger base than NO3-. This is because CN- can act as a Lewis base by donating a lone pair of electrons to a proton, while NO3- cannot readily donate electrons in the same way.

The correct name for NO3?

NO3 is known as nitrate.

What is the chemical formula for cobalt II nitrate?

The molecular formula is Co(NO3)2Co(NO3)2

What is the formula of iron and nitrate?

Iron nitrates are: - Fe(II)(NO3)2 - Fe(III)(NO3)3

What is the chemical formula for nitrate?

The formula for the nitrate ion is NO3 -1.

What is compound name for NO3?

Chromium (III) Nitrate

What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?

NI(NO3)3+pbbr4nibr3+pb(no3)4

What is the product if you multiply Mg by NO3?

Mg(NO3)2

What is the name for the formula NO3?

NO3 is commonly known as nitrate.

What is the product of NO3 and iron II?

the equation would look like: 2(NO3) + Fe --> Fe(NO3)2 the 2 in front of the NO3 is there to balance the equation.

What the name of Al(NO3)3?

Al(NO3)3 is aluminum nitrate.

Is Fe(NO3)2 Ionic or molecular?

Fe(NO3)2 is an ionic compound. Iron (Fe) is a metal and nitrate (NO3) is a polyatomic ion, so together they form an ionic bond in Fe(NO3)2.

Trending Questions

How dumb does helium make you? Is FAP a sex linked genetic disease and why? What city is at 33 Latitude N and 117 Longitude W? How do you hook a 220 volt treadmill to a 110 volt wall socket? What can use to change a 110v 60cycle inverter 50cycle? Why we use reducing agent in protein extraction? How many dust storms were there in 1934? What collection of two or more tissue types to produce a specialized function or process creates? What is fuel natural gas and uranium? What is Pluto' s orbit shape? To learn from a model scientist must? What is called the solute if the solvent is water? What is the human geography of Iceland? Why would people believe that today's Winchester 94 EA or AE models are based off the 1984 model - virtually unchanged? What are the four Main conditions bacteria need to survive and multiply? What group of elements already has a full shell? What are the historical facts about Florida? What is the Daily urine flow rate in female? What were typical employee conditions before the behavioral science movement? Why does sugar cubes dissolve in room temperature water?

Resources

Top Categories

Product

Company

Copyright ©2025 Answers.com. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.