0
Want this question answered?
Be notified when an answer is posted
Add your answer:
Earn +20 pts
What is the common name of Sodium Laureth Ether Sulphate?
it is ammonium sulfate but the sulfate ion has a 12 carbon long chain hanging where one of the ammoniums should be
Is sodium bicarbonate soluble in ether?
No, sodium bicarbonate is not soluable in ether.
Is sodium metal is insoluble in ether a chemical or physical reaction?
Insoluble
What is the product of reacting ether with NaOH and then HCL?
NaCl and H20 - sodium chloride salt and water.
Why is it necessary to add anhydrous magnesium sulphate to the alcohol and ether during the sodium test?
Anhydrous magnesium sulfate is a drying agent which removes water molecules which might cause contamination to the product. The high attraction for water molecules was due to the charged Mg2+ and SO42- ions. [2]
What is ethoxylated alcohol ether sulphate?
This is a detergent. The alcohol that is ethoxylated determines the length of the nonpolar part of the molecule. One example of this type of detergent is Sodium laureth sulfate, or sodium lauryl ether sulfate (SLES).
What is the common name of Sodium Laureth Ether Sulphate?
it is ammonium sulfate but the sulfate ion has a 12 carbon long chain hanging where one of the ammoniums should be
Is sodium bicarbonate soluble in ether?
No, sodium bicarbonate is not soluable in ether.
Does sodium chloride soluble to ether?
No.
What forms when ether is brought INto CONTACT WITh sodium metal?
oxygen
Do sodium salicylate react with water and diethyl ether?
no, but it dissolves
Is NaCl soluble inether?
Sodium chloride is not soluble in ether.
Will sodium chloride dissolve in diethyl ether?
No. Sodium chloride is polar, whereas diethyl ether is non-polar. Unlike solutes do not dissolve in unlike solvent. Only "like dissolves like".
Is sodium metal is insoluble in ether a chemical or physical reaction?
Insoluble
Why doesn't diethyl ether react with sodium?
Sodium ions react with other ionic species via electrostatic interactions. Diethyl ether does not contain any ionic functional groups, nor does it have acidic protons.
What is the difference between sodium sulfite and sodium sulfate?
No, these two chemicals are not the same. The difference is well-explained by the following excerpts from Wikipedia, accessed 2013 Feb 11:"[A generic] chemical formula for sodium laureth sulfate is CH3(CH2)10CH2(OCH2CH2)nOSO3Na. Sometimes the number represented by n is specified in the name, for example laureth-2 sulfate. The product is heterogeneous in the number of ethoxyl groups, where n is the mean. ... The related surfactant sodium lauryl sulfate (also known as sodium dodecyl sulfate or SLS) is produced similarly, but without the ethoxylation step."
Is sodium chloride is soluble in ether?
Sodium chloride is highly polar (ionic in fact) where hexane is very not. The two don't attract at all, so each is insoluble in the other.
