0
Icosane is a gray color.
Wiki User
∙ 8y ago
Add your answer:
Earn +20 pts
Why octane and not icosane uses as gasoline?
To be an efficient fuel for cars, a hydrocarbon must be able to vaporise at the pressure in the pistons of the engine. The minimum temperature before a fuel will vaporise is called the flash point. Relatively low flash points are good for fuel because once it is vapourised, the fuel effectively has the highest possible surface area possible, making it very easy to ignite (high rate of reaction).Good fuels must have a relatively low boiling point (but not too low, otherwise you get something called knocking, when the fuel vaporises too easily and actually ignites before the spark plug sparks it. The fuel ignites twice, making the cycle not as efficient as before because it is now out of sync).Octane has a chain of 8 carbons, and icosane has a chain of 20 carbons. More carbons in the chain means a higher relative molecular mass and usually a larger contact area for intermolecular forces (van der Waal's forces in hydrocarbons) to act. So generally, boiling points increase as the carbon chain lengthens, so icosane will have a much higher boiling point (hence flash point) than octane. In fact, at room temperature and pressure, octane is a liquid, but icosane is a solid. Imagine trying to fill up your car at the petrol (gas) station with solid lumps of fuel!The boiling points make all the difference. Hope this helped :)
What are the prefixes for hydrocarbons for 11-20?
1 meth 2 eth 3 prop 4 but 5 pent 6 hex 7 hept 8 oct 9 non 10 dec
What color is color itself?
Color isn't a color- it is a word.
How mold get color?
it get it color from the spors that is how it get it color
What is the color at the center of the color wheel?
the color at the center of the color wheel is white
What is the melting point of solid wax C20H42?
The melting point of icosane (C20H42) is 36-38 0C.
What is name of C20H44?
The highest possible hydrogen count on Cn-hydrocarbons is (2n+2), so here it would be correctly stated as (saturated alkane) C20H42 which is called icosane(icosa: meaning 20).C20H44 is not a possible formula, so there is no need to name it.
Why octane and not icosane uses as gasoline?
To be an efficient fuel for cars, a hydrocarbon must be able to vaporise at the pressure in the pistons of the engine. The minimum temperature before a fuel will vaporise is called the flash point. Relatively low flash points are good for fuel because once it is vapourised, the fuel effectively has the highest possible surface area possible, making it very easy to ignite (high rate of reaction).Good fuels must have a relatively low boiling point (but not too low, otherwise you get something called knocking, when the fuel vaporises too easily and actually ignites before the spark plug sparks it. The fuel ignites twice, making the cycle not as efficient as before because it is now out of sync).Octane has a chain of 8 carbons, and icosane has a chain of 20 carbons. More carbons in the chain means a higher relative molecular mass and usually a larger contact area for intermolecular forces (van der Waal's forces in hydrocarbons) to act. So generally, boiling points increase as the carbon chain lengthens, so icosane will have a much higher boiling point (hence flash point) than octane. In fact, at room temperature and pressure, octane is a liquid, but icosane is a solid. Imagine trying to fill up your car at the petrol (gas) station with solid lumps of fuel!The boiling points make all the difference. Hope this helped :)
What mass is the of 4.52 x 10-3 moles of C20H42?
There are two types and many other isomers of C20H42(wikipedia citation "It has 366,319"; all of them have different physical properties)1.n-Icosane (alternative spelling eicosane) Density of the UNbranched n-icosane: 932 mg mL−1 (at 20 °C)Molecular formula CH3(CH2)18CH32. IUPAC name: 2,6,10,14-Tetramethylhexadecane. Density 791 mg mL−1 (at 20 °C).Molecular formula: CH3CH(CH3)CH2CH2-(CH2CH(CH3)CH2CH2)-(CH2CH(CH3)CH2CH2)-CH2CH(CH3)CH2CH3
What are the prefixes for hydrocarbons for 11-20?
1 meth 2 eth 3 prop 4 but 5 pent 6 hex 7 hept 8 oct 9 non 10 dec
How did Livingstone decide to go to Africa?
[color=#BD0D65]H[/color][color=#BC0D66]e[/color][color=#BC0D68] [/color][color=#BB0E6A]d[/color][color=#BB0E6B]e[/color][color=#BA0F6D]c[/color][color=#BA0F6F]i[/color][color=#B90F70]d[/color][color=#B91072]e[/color][color=#B91074]d[/color][color=#B81175] [/color][color=#B81177]t[/color][color=#B71179]o[/color][color=#B7127A] [/color][color=#B6127C]g[/color][color=#B6137E]o[/color][color=#B61380] [/color][color=#B51381]b[/color][color=#B51483]e[/color][color=#B41485]c[/color][color=#B41586]a[/color][color=#B31588]u[/color][color=#B3158A]s[/color][color=#B2168B]e[/color][color=#B2168D] [/color][color=#B2178F]A[/color][color=#B11790]f[/color][color=#B11792]r[/color][color=#B01894]i[/color][color=#B01895]c[/color][color=#AF1997]a[/color][color=#AF1999] [/color][color=#AF1A9B]w[/color][color=#AE1A9C]a[/color][color=#AE1A9E]s[/color][color=#AD1BA0] [/color][color=#AD1BA1]i[/color][color=#AC1CA3]n[/color][color=#AC1CA5] [/color][color=#AB1CA6]n[/color][color=#AB1DA8]e[/color][color=#AB1DAA]e[/color][color=#AA1EAB]d[/color][color=#AA1EAD] [/color][color=#A91EAF]o[/color][color=#A91FB0]f[/color][color=#A81FB2] [/color][color=#A820B4]r[/color][color=#A820B6]e[/color][color=#A720B7]s[/color][color=#A721B9]o[/color][color=#A621BB]u[/color][color=#A622BC]r[/color][color=#A522BE]c[/color][color=#A522C0]e[/color][color=#A423C1]s[/color][color=#A423C3] [/color][color=#A424C5]t[/color][color=#A324C6]o[/color][color=#A324C8] [/color][color=#A225CA]l[/color][color=#A225CB]i[/color][color=#A126CD]v[/color][color=#A126CF]e[/color]
What is the job market for acting?
yes acting is hard, if we are talking about the good acting (well yes its hard), but if we are talking about the sloopy acting of course its easy. for acting you have to have a lot of concentration and you have to know a lot of basic things that most of the people that take classes of acting and that they are professional actors do bnot know. some of you people wont know what blocking a scene is, or maybe you guys dont know that you have to mantaing a balance on scene, also you have to know about diction and other stuff to, acting is not all about you learn your lines you do your part good and evreybody gives you a round of applusse. no an actor is much more thatn that. i know cause i am an actor and most of the people that i know that call themselves actor do not know some of thoose basic stuff.
What color is color itself?
Color isn't a color- it is a word.
What are the different shades of red?
PinkAAlizarinAmaranth (color)BBurgundy (color)Burnt siennaCCandy apple red (color)Cardinal (color)Carmine (color)Carnelian (color)Cerise (color)Chestnut (color)CoquelicotCoral (color)CrimsonFFalu redFire engine redFlame (color)Fuchsia (color)FulvousGGulesLLava (color)MMagentaMaroon (color)MauveMordant red 19PPersian redPersimmon (color)PuceRRaspberry (color)Red-violetR cont.Rose (color)Rose madderRosso corsaRuby (color)RuddyRufousRust (color)SSangria (color)Scarlet (color)TTerracottaTuscan RedUUpsdell redVVariations of magentaVariations of redVenetian redVermilion[taken from Wikipedia]
What is color and perspective when it comes to color?
Well Color = Color. haha But the Perspective of Color is Light.
Is the color green a color?
Yes, color green is considered a color.
What are the colors of the month?
January's color: Turquoise February's color: Silver March's color: Red April's color: brown May's color: Orange June's color: Yellow July's color: gold. August's color: Purple September's color: Pink October's color: Blue November's color: Black December's color: Green
