0
it makes our hair shiny and healthy
Wiki User
∙ 11y ago
Add your answer:
Earn +20 pts
Is dove shampoo Sodium Laureth Sulfate free?
No
Is sodium laureth sulfate an ionic or covalent compound?
The chemical formula of sodium laureth sulfate is CH3(CH2)11(OCH2CH2)nOSO3Na.This compound is an anionic surfactant.
Are sodium laurel sulfate ans sodium lauryl sulfoacetate the same?
Yes ! Sodium laurel sulfate=Sodium lauryl sulfate=Sodium dodecyl sulfate (CH3(CH2)11OSO3Na). But sodium laureth sulfate is a different compound.
What is the common name of Sodium Laureth Ether Sulphate?
it is ammonium sulfate but the sulfate ion has a 12 carbon long chain hanging where one of the ammoniums should be
What is dish soap made out of?
It's made out of water, sodium lauryl sulfrate, sodium laureth sulfate, alcohol, and sodium chloride :)
What does abbreviation SLS stand for?
sodium laureth sulfate
Is dove shampoo Sodium Laureth Sulfate free?
No
Is sodium laureth sulfate an ionic or covalent compound?
The chemical formula of sodium laureth sulfate is CH3(CH2)11(OCH2CH2)nOSO3Na.This compound is an anionic surfactant.
What is the main component of shampoo?
water and sodium laureth sulfate.
Are sodium laurel sulfate ans sodium lauryl sulfoacetate the same?
Yes ! Sodium laurel sulfate=Sodium lauryl sulfate=Sodium dodecyl sulfate (CH3(CH2)11OSO3Na). But sodium laureth sulfate is a different compound.
Is aqua sodium laureth sulfate acid or alkali?
This compound is an anionic detergent.
What is the common name of Sodium Laureth Ether Sulphate?
it is ammonium sulfate but the sulfate ion has a 12 carbon long chain hanging where one of the ammoniums should be
List of sodium laureth sulfate free shampoos in India?
There are several SLS or sodium laureth sulfate free shampoos that are available in India. These include Pureology Nano Works shampoo and Organix Rejuvenating Cherry Blossom Ginseng shampoo.
What is dish soap made out of?
It's made out of water, sodium lauryl sulfrate, sodium laureth sulfate, alcohol, and sodium chloride :)
What is the difference between sodium sulfite and sodium sulfate?
No, these two chemicals are not the same. The difference is well-explained by the following excerpts from Wikipedia, accessed 2013 Feb 11:"[A generic] chemical formula for sodium laureth sulfate is CH3(CH2)10CH2(OCH2CH2)nOSO3Na. Sometimes the number represented by n is specified in the name, for example laureth-2 sulfate. The product is heterogeneous in the number of ethoxyl groups, where n is the mean. ... The related surfactant sodium lauryl sulfate (also known as sodium dodecyl sulfate or SLS) is produced similarly, but without the ethoxylation step."
What is the ingredients in Head and Shoulders shampoo?
The ingredient list says Pyrithione zinc, water, sodium laureth sulfate, sodium lauryl sulfate, cocamide MEA, zinc carbonate, glycol distearate, dimethicone, fragrance, cetyl alcohol, guar hydroxypropyltrimonium chloride, magnesium sulfate, sodium benzoate, magnesium carbonate hydroxide, ammonium laureth sulfate, benzyl alcohol, sodium chloride, methylchloroisothiazolinone, methylisothiazolinone, sodium xylenesulfonate, blue 1, red 4.
Which shampoo ingredients are too harsh and cause scalp itch?
sodium laureth sulfate is the most common
