0
Ethyl dimethyl heptane means essentially is a 7 C chain with a C2H5 group and two CH3 group (both attaching to the same carbon atom) attached to it. For more specific structure, a more detailed naming of the compound is needed. For instance, "2-ethyl-3,3-dimethyl-heptane" represents the structure CH3CH2(C2H5)CH(CH3)2C4H9. However, if one were to type the name "ethyl-dimethyl-heptane" in the software "ChemDraw" and convert it into a structure of the compound, the resulted conversion is in the form of "1-ethyl-1,1-dimethyl-heptane" or rather "3,3-dimethylnonane".
Wiki User
∙ 17y ago
Wiki User
∙ 12y agoThe simple structural formula of 2-(methyl)-3-(n-propyl)-heptane is:
CH3-CH(CH3)-CH(CH2CH2CH3)-CH2-CH2-CH2-CH3
or the one of 2-(methyl)-3-(iso-propyl)-heptane is:
CH3-CH(CH3)-CH(CH(CH3)2)-CH2-CH2-CH2-CH3
Add your answer:
Earn +20 pts
What is this structure?
What sentence structure is this? - It is a simple structure for an interrogative sentence.
What type of structure are ice skates ( soild structure frame structure or shell structure.)?
i feel like a uchia
Structure of L asparginase?
structure of L asparginase structure of L asparginase
Two Examples of a non-silicate structure?
Ice structure and Diamond structure.(two more examples of a non-silicate structure: Pyrite structure and natural gas hydrates).
What is colotomic structure?
what is clotomic structure
What is meant by a structure within a structure?
A structure that is a member of another structure is a structure within a structure.
Differentiate the four types of protein structure?
There are four types of protein structure. These include primary structure, secondary structure, tertiary structure, and quaternary structure. Primary structure is the amino acid sequence. Secondary structure is the shape of the molecule. Tertiary structure is the interaction between groups. Quaternary structure is the interactions between protein subunits.
What is the difference between a matrix structure and a organisational structure?
the difference between an organisational structure and a matrix structure is that a matrix structure is a combined structure whereas an organisational structure is in a vertical order and has different levels.
Can you give a hard science question?
What is the DNA structure of a brontosaurus.What is the DNA structure of a brontosaurus.What is the DNA structure of a brontosaurus.What is the DNA structure of a brontosaurus.What is the DNA structure of a brontosaurus.What is the DNA structure of a brontosaurus.
What is surface structure in engineering?
surface structure is a structure at the surface
What is this structure?
What sentence structure is this? - It is a simple structure for an interrogative sentence.
What does structure you?
cells structure you
What is the structure of to celia?
Celia does not have a structure. It is the only cell part that does not have a structure.
What is a hotel structure?
hotel structure is a structure composes of many organizations
What is capital structure decisions?
capital structure decisions are structure with decisions
What type of structure are ice skates ( soild structure frame structure or shell structure.)?
i feel like a uchia
Organisational structure of reliance fresh?
reliance fresh structure reliance fresh structure reliance fresh structure
