0
A bubble is not a substance, it is a physical structure that can form in virtually any liquid. Because of this bubbles do not have a definite composition and so do not have a chemical formula.
Wiki User
∙ 11y ago
Wiki User
∙ 14y agoBubbles are a sign that a chemical reaction is taking place. Soap bubbles when mixed with water because a gas is being formed when the water molecule and soap molecules collide, bonds are broken, and new bonds are formed. The soap molecule has two different ends, a hydrophilic end (loves water) and a hydrophobic end (fears water). The hydrophobic end attaches to non-polar molecules, such as dirt and grease on your hands and surrounds it, while the hydrophilic ends encase the greasy particles within bubbles essentially and 'dissolve' into the water, thus being attracted to the water molecules and getting washed down the sink when you wash your hands, leaving your hands feeling clean. If your hands feel slippery after, such as when you wash your hands with dishwashing detergent, it is because the soap, a base, hasn't all washed off your hands and bases feel slippery.
Wiki User
∙ 13y agoIt depends in which context in fizzy drinks it is carbon dixoide which is also in bubbles which are blown through washing up liquid.
Wiki User
∙ 15y agoSodium (Na) and Lithium (Li) both give of Hydrogen rapidly when placed in water and need to be stored carefully. Carbon dioxide is in soft drinks and gives it its' fizz.
Wiki User
∙ 14y agoThey are basically fatty acids or esters of fatty acids namely,
Palmitic Acid CH3(CH2)14COOH
Stearic Acid C18H36O2, or CH3(CH2)16COOH
Oleic Acid CH3(CH2)7CH=CH(CH2)7COOH.
Add your answer:
Earn +20 pts
What is the difference between closed cell foam insulation and open cell foam insulation?
Closed-cell foam insulation differs from open cell foam insulation in the fact that closed-cell foam insulation has tiny foams cells that are closed and packed together. They are filled with gas that helps the foam rise. Open cell foam does not have this characteristic.
As the company's materials scientist, you will test the core foam. What criteria do you want the foam to meet?
As the company's materials scientist, you will test the core foam. What criteria do you want the foam to meet?
Is a foam pillow a conductor or an insulator?
This depends on the type of foam. There have been made foam that actually conduct electricity. This is a choice made in the manufacturing of the foam. Most foam in mattresses and the like does not conduct electricity. Moisture however can change the mattresses conductivity drastically.
What are the advantages of foam board?
hi, the main advantage of using a foam board is that it is light and also strong.
Does metal or foam keep water hotter longer?
In general, foam is a better insulator than metal, and so foam would be expected to keep water hotter longer under most normal circumstances.
How does nitrogen react with other chemicals?
by the combinement and combitnation of other chemicals which make it fuzz frizz or foam
What gases are in firefighters foam?
The foam is not gas, but chemicals that prevent the fuel source in a fire from receiving the oxygen needed to sustain a fire.
What is foam rubber?
Foam rubber it is made up with a foaming agent for creating an air-filledmatrix structure. Those foam rubbers are normally either polyurethane foam or natural foam rubber latex.Foam rubber can also created from chemicals polyol,Latex foam rubber.Used in:mattressesInsulationFurniturePackagingCostumes
How can you add glycerin in formulation of flexible polyurethane foam?
Glycerin in flexible polyurethane foam is added as part per hundred of water and not of Polyol as it is for other chemicals for flexible foam. Olaoluwa Ogunfeyitimi
What did you see when you mixed the vinegar and the baking soda?
you get CO2 and other chemicals that flows out as bubbling foam
Can foam give you cancer?
This is highly dependent on what chemicals are present in the foam. If it has been tainted with something such as radium or tritium, radiation could cause cells to become cancerous.
What is in the mixture for foam?
Yes glue is a mixture, and it is also a solution.
What is the conclusion of elephant tooth paste?
Sorry di ko alam google tanugin mo:">
Why do pop rocks make coke fizz?
it is due to the carbon dioxide reacting with the chemicals in the coke making it foam.
What makes the eco-friendly 2-inch memory foam Mattress pad eco-friendly?
Eco-friendly foam is made from chemicals that are less hazardous to produce, but are still just as comfortable.
Why is the froth on beer white and the froth on coke-cola brown?
This is because the two different types of foam have different chemicals in them.
What are the health risks from using a memory foam mattress?
Memory foam is polyurethane with additional chemicals increasing its viscosity and density. A lower density memory foam is pressure sensitive and molds quickly to the shape of a body pressing against it, returing to its original shape once the pressure is removed.
