Air is made up of 16% Oxygen, 1% Hydrogen, and 78% Nitrogen but the actual formula is not very known. Does anyone knowwhat the actual is when they are put together and not just three elements alone?
i would say that air doesnt have a chemical formula because the parts are not chemically combined, therefore, air is a mixture.
The actual mixture of air is 78.084% Nitrogen, 20.946% Oxygen, 0.934% Argon, 0.033% Carbon Dioxide. This does very slightly due to environmental conditions.
Respiration or breathing. respiration is the more scientific term. The scientific formula for respiration is O2+C6H12O6(glucose)=CO2+H2O
The scientific formula for oxygen gas is O2, indicating that it consists of two oxygen atoms bonded together.
The chemical formula for pyrite is FeS2, which is iron sulfide.
The scientific name for marble chips is calcium carbonate, which is a chemical compound with the formula CaCO3.
Limestone is chiefly calcium carbonate, or CaCO3.
There is no formula for scientific energy.
the scientific formula is H2O
"2 plus 2" is not a scientific formula. In fact, it is not a formula of any sort.
Respiration or breathing. respiration is the more scientific term. The scientific formula for respiration is O2+C6H12O6(glucose)=CO2+H2O
Formula: Na3P
Mass
The scientific formula for oxygen gas is O2, indicating that it consists of two oxygen atoms bonded together.
The scientific expression is solid-air aerosols.
The answer will depend on the exact form of the formula.
The scientific formula H2O represents water, which is a compound made up of two hydrogen atoms and one oxygen atom.
The chemical formula for fool's gold is FeS2, and its scientific name is iron pyrite.
Power = (energy)/(time)