0
The structural formula is CH3COOCH2CH3
Wiki User
∙ 11y ago
Wiki User
∙ 12y agoA methanoate is a salt or ester of methanoic (or formic) acid, containing the COOH radical. Sodium methanoate has the formula NaCOOH.
lenpollock
Ethyl ethanoate
CH3-C(=O)-O-CH2-CH3
Similarly
propyl ethanoate is
CH3-C(=O)-O-CH2-CH2-CH3
Similarly
Ethyl Butanoate
CH3-CH2-CH2-C(=O)-O-CH2-CH3
Wiki User
∙ 13y agoFormula: CH3COOC2H5
Wiki User
∙ 13y agoFormula: CH3COOC2H5
Wiki User
∙ 8y agoIt is CH3COO
Wiki User
∙ 7y agoIt's CH3COOCH2CH3
Wiki User
∙ 15y agoCH3COOH
Add your answer:
Earn +20 pts
What is the structural formula chemical equation for ethyl ethanoate plus water?
CH3CH2OOCCH3 + H2O ===> CH3CH2OH + CH3COOH
What is the chemical formula of strawberry extract?
(2S,3R)-ethyl 3-methyl-3-phenyloxirane-2-carboxylate
If you boil ethyl alcohol does the chemical structure change?
No. The chemical structure of ethyl alcohol gas is the same as ethyl alcohol liquid.
What chemicals are used in biodiesel?
Biodiesel is composed of Fatty Acids with Methyl, Propyl or Ethyl Esters. Some common forms of biodiesel are Methyl Linoleate and Ethyl Stearate. ==Methyl Linoleate== Chemical Formula: C19H34O2 ==Ethyl Stearate== Chemical Formula: C20H40O2
What is the formula of ethylalcohal?
Ethyl (grain) alcohol has the formula of C2H5OH.
What is the chemical formula of ethyl alcohol?
C2h5oh
How do you draw the chemical formula for ethyl acetate?
ch3cooc2h5
Chemical formula for ethyl acetate?
Molecular formula is C2H5CH3COO . Structural formula is CH3COOCH2CH3 .
What is the chemical formula and IUPAC name of acetic acid?
The chemical formula of acetic acid is CH3COOH; the IUPAC name is ethanoic acid.
What are two products of saponification?
Ethyl Alcohol + Ethanoic Acid
What masses of ethanol and ethanoic acid would need to react together to give 1g of ethyl ethanoate?
0.52g of ethanol and 0.72g of ethanoic acid react to give 1g of ethyl ethanoate.
Combustion of 2.22 mg of ethyl butyrate produces 5.06 mg of CO2 and 2.06 mg of H20 what is the empirical formula?
The chemical formula of ethyl butirate is C6H12O2.
What is the chemical formula for ethyl alcohol?
C2h5-oh
What is another word for ethanoic acid?
Acetic Acid. In the modern IUPAC Nomenclature it is 'Ethanoic Acid' The old cammercial name is 'Acetic Acid'. The chemical formula/structure is 'CH3COOH'.
What is the reaction of ethanoic acid and ethylamine?
It is an endothermic reaction resulting in N-ethyl ethanamide and water
What is the product when ethanol react with ethanoic acid?
The products are ethyl ethanoate and water. Here is the reaction equation. CH3COOH + CH3CH2OH CH3COOCH2CH3 + H2O It is a dynamic equalibrium . It requirted a little sulphuric Acid(H^+) and gentle heat to set it going.
What is the structural formula chemical equation for ethyl ethanoate plus water?
CH3CH2OOCCH3 + H2O ===> CH3CH2OH + CH3COOH
