Tags Elements and Compounds

Animals & Plants Arts & Entertainment Auto Beauty & Health Books and Literature Business Electronics Engineering & Technology Food & Drink History Hobbies Jobs & Education Law & Government Math People & Society Science Social Studies Sports Travel & Places

0

Subjects>Science>Chemistry

What is word equation for sodium with water?

Updated: 9/27/2023

Wiki User

∙ 6y ago

Want this question answered?

Be notified when an answer is posted

Add your answer:

Earn +20 pts

Q: What is word equation for sodium with water?

Write your answer...

Submit

Still have questions?

imp

Continue Learning about Chemistry

What is the word equation for sodium plus water?

Sodium plus water -> sodium oxide

What is the the word equation for hydrochloric acid with sodium hydroxide?

Sodium hydroxide plus hydrochloric acid equals sodium chloride plus water.

What is the word equation for carbon dioxide water and sodium acetate?

I dont know dont ask me

Sodium acetate and water chemical equation?

the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).

What is the balenced equation of dissolving sodium in water produces sodium oxide and hydrogen?

Sodium reacts with water to form sodium hydroxide and hydrogen. The balanced equation is 2Na + 2H2O --> 2NaOH + H2.

Related questions

What is the word equation for sodium plus water?

Sodium plus water -> sodium oxide

What is the word equation for making sodium sulphate and water?

Sodium + Sulphate + Water = Sodium Sulphate + Water

What is the word equation for sodium hydroxide?

Sodium Hydroxide + Hydrocloric acid --> Sodiumchloride + Water

What is the the word equation for hydrochloric acid with sodium hydroxide?

Sodium hydroxide plus hydrochloric acid equals sodium chloride plus water.

What is the word equation for carbon dioxide water and sodium acetate?

I dont know dont ask me

Sodium acetate and water chemical equation?

the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).

What is the word equation for the reaction of Li Na and K with H2O?

Lithium + water = lithium hydroxide + hydrogen Sodium + water = Sodium hydroxide + hydrogen Potassium + water = Potassium hydroxide + hydrogen

What is the balenced equation of dissolving sodium in water produces sodium oxide and hydrogen?

Sodium reacts with water to form sodium hydroxide and hydrogen. The balanced equation is 2Na + 2H2O --> 2NaOH + H2.

What is the word equation for the reaction of sulphuric acid and sodium hydrogen carbonate?

Sulphuric acid reacts with sodium hydrogen carbonate to produce sodium sulfate, carbon dioxide, and water.

Write the word equations and chemical equation for the reactions of sodium with oxygen?

Word equation:sodium + oxygen => sodium oxideSymbol equation:4Na + O2 => 2Na2O

What is the equation for sodium reacting with water?

Sodium reacting with water is: 2Na + 2H2O ----> 2NaOH + H2

Word equation for the reaction of halogens with sodium?

Sodium plus Halogen yields Sodium Halide

Trending Questions

How do you type h2o? What is the formula for getting copper oxide from copper hydroxide? What is the chemical formula of lead II chromate? Is benzene combustion a chemical or physical reaction? Is Si covalent? What two colors do you mix to create orange? The visible smoke coming out of a chimney is called? What 2 compounds contain lithium sulphur and oxygen? What is the hybridization of the bromine atom in BrF5? How do you test potassium formate in the laboratory? How many grams of water are released when a 10.0-g sample of CaSO42H2O? Who discovered ununbium? What is the pH of pancreatin? Is S8 organic compound? What is in simple green cleaner? How do you remove glitter glue from a suede jacket? Is a chemical peel bad? Is fingernails an inorganic or organic compound? Is zinc sulfate polar? What is more acidic coke or sprite?

Still have questions?

imp

Previously Viewed

What is word equation for sodium with water?

Resources

Top Categories

Product

Company

Copyright ©2024 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.