A bubble is not a substance, it is a physical structure that can form in virtually any liquid. Because of this bubbles do not have a definite composition and so do not have a chemical formula.
Bubbles are a sign that a chemical reaction is taking place. Soap bubbles when mixed with water because a gas is being formed when the water molecule and soap molecules collide, bonds are broken, and new bonds are formed. The soap molecule has two different ends, a hydrophilic end (loves water) and a hydrophobic end (fears water). The hydrophobic end attaches to non-polar molecules, such as dirt and grease on your hands and surrounds it, while the hydrophilic ends encase the greasy particles within bubbles essentially and 'dissolve' into the water, thus being attracted to the water molecules and getting washed down the sink when you wash your hands, leaving your hands feeling clean. If your hands feel slippery after, such as when you wash your hands with dishwashing detergent, it is because the soap, a base, hasn't all washed off your hands and bases feel slippery.
It depends in which context in fizzy drinks it is carbon dixoide which is also in bubbles which are blown through washing up liquid.
Sodium (Na) and Lithium (Li) both give of Hydrogen rapidly when placed in water and need to be stored carefully. Carbon dioxide is in soft drinks and gives it its' fizz.
They are basically fatty acids or esters of fatty acids namely,
Palmitic Acid CH3(CH2)14COOH
Stearic Acid C18H36O2, or CH3(CH2)16COOH
Oleic Acid CH3(CH2)7CH=CH(CH2)7COOH.
Closed-cell foam insulation differs from open cell foam insulation in the fact that closed-cell foam insulation has tiny foams cells that are closed and packed together. They are filled with gas that helps the foam rise. Open cell foam does not have this characteristic.
As the company's materials scientist, you will test the core foam. What criteria do you want the foam to meet?
This depends on the type of foam. There have been made foam that actually conduct electricity. This is a choice made in the manufacturing of the foam. Most foam in mattresses and the like does not conduct electricity. Moisture however can change the mattresses conductivity drastically.
hi, the main advantage of using a foam board is that it is light and also strong.
In general, foam is a better insulator than metal, and so foam would be expected to keep water hotter longer under most normal circumstances.
by the combinement and combitnation of other chemicals which make it fuzz frizz or foam
The foam is not gas, but chemicals that prevent the fuel source in a fire from receiving the oxygen needed to sustain a fire.
Foam rubber it is made up with a foaming agent for creating an air-filledmatrix structure. Those foam rubbers are normally either polyurethane foam or natural foam rubber latex.Foam rubber can also created from chemicals polyol,Latex foam rubber.Used in:mattressesInsulationFurniturePackagingCostumes
you get CO2 and other chemicals that flows out as bubbling foam
This is highly dependent on what chemicals are present in the foam. If it has been tainted with something such as radium or tritium, radiation could cause cells to become cancerous.
Yes glue is a mixture, and it is also a solution.
Sorry di ko alam google tanugin mo:">
it is due to the carbon dioxide reacting with the chemicals in the coke making it foam.
Eco-friendly foam is made from chemicals that are less hazardous to produce, but are still just as comfortable.
This is because the two different types of foam have different chemicals in them.
Memory foam is polyurethane with additional chemicals increasing its viscosity and density. A lower density memory foam is pressure sensitive and molds quickly to the shape of a body pressing against it, returing to its original shape once the pressure is removed.
In order to produce foam, several things are required. First, the surface area needs to be increased. Soap bubbles are a type of foam, for instance. The surface area is increased by applying force. Next, certain reactive chemicals are required. In the case of soap bubbles, soap is required. There are many different types of foam, such as styrofoam, all requiring different levels of force and substances. Sea foam is another type of foam.