answersLogoWhite

0

Which chemicals are in a foam?

Updated: 8/11/2023
User Avatar

Wiki User

14y ago

Best Answer

A bubble is not a substance, it is a physical structure that can form in virtually any liquid. Because of this bubbles do not have a definite composition and so do not have a chemical formula.

User Avatar

Wiki User

11y ago
This answer is:
User Avatar
More answers
User Avatar

Wiki User

14y ago

Bubbles are a sign that a chemical reaction is taking place. Soap bubbles when mixed with water because a gas is being formed when the water molecule and soap molecules collide, bonds are broken, and new bonds are formed. The soap molecule has two different ends, a hydrophilic end (loves water) and a hydrophobic end (fears water). The hydrophobic end attaches to non-polar molecules, such as dirt and grease on your hands and surrounds it, while the hydrophilic ends encase the greasy particles within bubbles essentially and 'dissolve' into the water, thus being attracted to the water molecules and getting washed down the sink when you wash your hands, leaving your hands feeling clean. If your hands feel slippery after, such as when you wash your hands with dishwashing detergent, it is because the soap, a base, hasn't all washed off your hands and bases feel slippery.

This answer is:
User Avatar

User Avatar

Wiki User

13y ago

It depends in which context in fizzy drinks it is carbon dixoide which is also in bubbles which are blown through washing up liquid.

This answer is:
User Avatar

User Avatar

Wiki User

15y ago

Sodium (Na) and Lithium (Li) both give of Hydrogen rapidly when placed in water and need to be stored carefully. Carbon dioxide is in soft drinks and gives it its' fizz.

This answer is:
User Avatar

User Avatar

Wiki User

14y ago

They are basically fatty acids or esters of fatty acids namely,

Palmitic Acid CH3(CH2)14COOH

Stearic Acid C18H36O2, or CH3(CH2)16COOH

Oleic Acid CH3(CH2)7CH=CH(CH2)7COOH.

This answer is:
User Avatar

Add your answer:

Earn +20 pts
Q: Which chemicals are in a foam?
Write your answer...
Submit
Still have questions?
magnify glass
imp
Related questions

How does nitrogen react with other chemicals?

by the combinement and combitnation of other chemicals which make it fuzz frizz or foam


What gases are in firefighters foam?

The foam is not gas, but chemicals that prevent the fuel source in a fire from receiving the oxygen needed to sustain a fire.


What is foam rubber?

Foam rubber it is made up with a foaming agent for creating an air-filledmatrix structure. Those foam rubbers are normally either polyurethane foam or natural foam rubber latex.Foam rubber can also created from chemicals polyol,Latex foam rubber.Used in:mattressesInsulationFurniturePackagingCostumes


What did you see when you mixed the vinegar and the baking soda?

you get CO2 and other chemicals that flows out as bubbling foam


Can foam give you cancer?

This is highly dependent on what chemicals are present in the foam. If it has been tainted with something such as radium or tritium, radiation could cause cells to become cancerous.


What is in the mixture for foam?

Yes glue is a mixture, and it is also a solution.


What is the conclusion of elephant tooth paste?

Sorry di ko alam google tanugin mo:">


Why do pop rocks make coke fizz?

it is due to the carbon dioxide reacting with the chemicals in the coke making it foam.


What makes the eco-friendly 2-inch memory foam Mattress pad eco-friendly?

Eco-friendly foam is made from chemicals that are less hazardous to produce, but are still just as comfortable.


Why is the froth on beer white and the froth on coke-cola brown?

This is because the two different types of foam have different chemicals in them.


What are the health risks from using a memory foam mattress?

Memory foam is polyurethane with additional chemicals increasing its viscosity and density. A lower density memory foam is pressure sensitive and molds quickly to the shape of a body pressing against it, returing to its original shape once the pressure is removed.


What are the conditions needed to produce foam?

In order to produce foam, several things are required. First, the surface area needs to be increased. Soap bubbles are a type of foam, for instance. The surface area is increased by applying force. Next, certain reactive chemicals are required. In the case of soap bubbles, soap is required. There are many different types of foam, such as styrofoam, all requiring different levels of force and substances. Sea foam is another type of foam.