0
Breathing, digestion and heartbeat are all considered automatic body functions, because you don't have to think about them. Yes, you can hold your breath, or hyperventilate, but you don't have to "remember" to breathe.
Wiki User
∙ 14y ago
Wiki User
∙ 13y agoBreathing is an instinct because we do it subconsciously. Our minds do not continually think "inhale...exhale." It is a basic body function already programmed into our bodies that does not need to be taught to us for us to do it.
Add your answer:
Earn +20 pts
Is breathing somatic or autonomic?
Since you don't have to think about breathing, it is automatic.
What is the process called when the carbon dioxide leaves the animal?
breathing
What part of the brain controls the automatic functions of breathing and heart rate?
medulla oblongata
What is the process of taking in air into your body and giving it out is called?
Respiration or breathing. respiration is the more scientific term. The scientific formula for respiration is O2+C6H12O6(glucose)=CO2+H2O
The brainstem stimulates breathing on the basis of?
This is an automatic nerve flex and run by the autonomic nervous system.
What is the breathing process in plant called?
photolysis
Is breathing somatic or autonomic?
Since you don't have to think about breathing, it is automatic.
What is the process called when the carbon dioxide leaves the animal?
breathing
Sometimes I forget to breath I don't understand why but at least once a day while I'm just doing my own thing I realize I'm not breathing and then I have to try to force myself to breath?
Breathing is an automatic process. If you feel that you are not breathing you may have anxiety issues. You should see a doctor. If it is determined that you do in fact stop breathing then you need to see a pulmonologist.
what is to breath?
The opposite to breathing in
Breathing out is an example of this life process?
the respritory process
What is inspiration and exhalation?
Inspiration, as called inhalation, moves air into the lungs. Expiration, as called exhalation, moves air out of the lungs.
Is respiration and breathing same process?
Repiration and Breathing are not the same process. Respiration is converting glucose to useable energy.
What process is breathing out carbon dioxide part of?
Respiration is breathing in and absorbing oxygen, and breathing out carbon dioxide.
Is breathing a inflammatory process?
Breathing is not an inflammatory process. An inflammatory process is where the body's immunity system through the white blood cells will respond to a particular injury.
What are the changes taking place in your body including breathing in and out?
At the time of breathing diaphragm streaches and air comes in containing oxygen, as diaphragm constricts air containing carbon di oxide air comes out.This process is called as breathing.
What are 3 Differences between Respiration and Breathing?
Breathing is the process wherein the living organism inhales oxygen and exhales carbon dioxide, whereas respiration is the process that uses oxygen to produce energy. Breathing is a physical process, but respiration is a chemical process. Breathing occurs with the help of organs like nose, mouth, lungs
