0
What are some Chemical equations for oxidation of sodium acetate?
Wiki User
∙ 12y ago
Sodium Acetate Can be fond in 2 forms. Either anhydrous or trihydrate. Oxidation reaction with anhydrous form is easier than trihydrate form. First form has reaction similar to that of Oxidation of Acetic Acid. Trihydrate form is a bit more complex and I'm still loking into it
Wiki User
∙ 12y ago
Wiki User
∙ 16y agoOne reaction forming sodium acetate:
NaOH + CH3COOC2H5 -> CH3COONa + C2H5OH
Sodium Hydroxide + Ethyl Acetate -> Sodium Acetate + ethanol
Add your answer:
Earn +20 pts
What is the name for the chemical formula NaOCOCH3?
Sodium acetate or Sodium ethanoate
What is the name for this chemical compound CH3COONa?
It is the formula for the chemical compound Sodium Ethanoate (the chemical name). It's called Sodium Acetate in everyday terms.
You sodium acetate a element a compound or a mixture?
Sodium Ethanoate (Acetate) is a COMPOUND. It is the sodium salt of ethanoic(acetic) acid. It formula is CH3COO^-Na^+
What is the compound name of NaC2H3O2?
sodium acetateThe chemical name for NaC2H3O2 is sodium acetate.
What is the reaction for Sodium acetate plus H2O?
Sodium acetate gets dissociated and solvated in water. CH3COONa + H2O = CH3COO-(aq) + Na+(aq)
What is the name for the chemical formula NaOCOCH3?
Sodium acetate or Sodium ethanoate
Is sodium acetate a mixture compound or element?
Sodium acetate is a chemical compound.
What is in the sodium acetate?
Sodium Ethanoate/Acetate is made from Carbon, Sodium, Hydrogen, and Oxygen, with the chemical formula C2H3NaO2
What has sodium acetate in it?
The chemical formula of sodium acetate is NaC2H3O2; contain C, H, O and Na.
What is the name for this chemical compound CH3COONa?
It is the formula for the chemical compound Sodium Ethanoate (the chemical name). It's called Sodium Acetate in everyday terms.
What contains sodium acetate?
Sodium acetate with the chemical formula NaC2H3O2 contain Na, C, O and H.
What substance has the chemical formula CH3COONa H2O?
The substance with the chemical formula CH3COONa H2O is sodium acetate monohydrate, which is a hydrated form of sodium acetate. It is commonly used as a buffering agent and in the production of pharmaceuticals and food additives.
Sodium acetate and water chemical equation?
the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).
You sodium acetate a element a compound or a mixture?
Sodium Ethanoate (Acetate) is a COMPOUND. It is the sodium salt of ethanoic(acetic) acid. It formula is CH3COO^-Na^+
What elements does sodium acetate contains?
Sodium, carbon, hydrogen, oxygen. The formula is NaC2H3O2.
What is CH3COOAg?
CH3COO4- (C2H3O5-) is the chemical formula of the 2-hydroperoxy-2-hydroxy-acetate anion. Of course if the 4 was a typo for H it would be acetic acid. If there are brackets (CH3COO)4 its the tetracacetate portion of the formula of a salt such as lead(IV) acetate.
What is the chemical name for NaHCO3 and NaC2H3O2?
NaHCO3 is sodium bicarbonate. NaC2H3O2 is sodium acetate.
