0
The empirical formula for adenine is CHN.
The molecular formula is C5H5N5.
Wiki User
∙ 15y ago
Add your answer:
Earn +20 pts
How are adenine and thymine different?
Adenine and thymine are both nitrogenous bases.Adenine is a purine, meaning it has a six-membered ring of carbon and nitrogen atoms fused together with a five-membered ring of carbon and nitrogen atoms. The chemical formula of adenine is C5H5N5.Thymine is smaller; it is a pyrimidine, meaning it has a six-membered ring of carbon and nitrogen atoms. The chemical formula for thymine is C5H6N2O2.
What nucleotide does Adenine bind?
In DNA adenine binds to thymine. In RNA adenine binds to uracil. Adenine can also bind the modified nucleotide base inosine.
In DNA what does adenine always pair up with?
In DNA replication, adenine binds with thymine. In RNA, adenine binds with uracil.
What are the 4 different bases in DNA?
A-Adenine C-Cytosine T-thymine G-guanine
What two purines are in DNA?
Adenine and guanine .
What is the simple formula of adenine?
C5h5n5
What is the chemical formula for adenine triphosophate?
C10H8N4O2NH2(OH)2(PO3H)3H
How many adenine molecules are in ATP?
There are five carbon atoms in adenine.Its molecular formula is C5H5N5.For structural formulae, see the link below.
How are adenine and thymine different?
Adenine and thymine are both nitrogenous bases.Adenine is a purine, meaning it has a six-membered ring of carbon and nitrogen atoms fused together with a five-membered ring of carbon and nitrogen atoms. The chemical formula of adenine is C5H5N5.Thymine is smaller; it is a pyrimidine, meaning it has a six-membered ring of carbon and nitrogen atoms. The chemical formula for thymine is C5H6N2O2.
What two bases are in purines?
Adenine and guanine are the two purines bases present in DNA.Two purines in DNA are adenine and guanine.
What percentage of the bases in this sample are adenine?
Yeast with adenine-31.3% has the percentage of adenine.
What is the sequence a-c-t-a-g-c-a-t-a?
Adenine-Cytosine-Thymine-Adenine-Guanine-Cytosine-Adenine-Thymine-Adenine
What does Adenine A bond with?
Adenine bonds with thymine in DNA and uracil in RNA.
Why adenine never pairs with another adenine?
Adenine is a nucleotide base. These pair with other complimentary nucleotide bases. Therefore Adenine could not pair with another Adenine as they have the same shape, not a complimentary shape.
What always pairs up with adenine?
In DNA adenine pairs with thymine. In RNA adenine pairs with uracil.
What nucleotide does Adenine bind?
In DNA adenine binds to thymine. In RNA adenine binds to uracil. Adenine can also bind the modified nucleotide base inosine.
What does adenine bind with?
Adenine always binds with thymine.
