Can a 15-year-old leave their home without their parents' permission? How many 3 digit numbers are there in between 97 to 201 which are divisible by 3 reema calculated it by using arithmetic progression while ritu calculated it directly which value is depicted by reema? What can an iDock be used for? Why front end wobbles at lower speed? Who is playing drums with The Byrds on Top of the Pops? What is the duration of It's a Wonderful Afterlife? Why do women in the community attend the funeral in a rose for Emily? How many gas gallons does a 1996 Ford Aerostar hold? How many inches are in 31cm? Is there any air transportation besides airplane and helicopter? How many times is the word 'lips' mentioned in the Bible? What is Molecular mass of CH3(CH2)11(OCH2CH2)nOSO3Na? Where is the Dimensions Of Marble Inc in Mendon Vermont located? Is there a free phone number for the RSPCA? What is a sophomoric person? How many times can a prime minister be reelected? What do you mean by illusion in terms of biology? Why should you not pollute? How much bigger is a liter than a quart? Is it true Jefferson's aim as stated in his inaugural address was to let the people regulate their own pursuits of industry and profit?