0
Yes!
Wiki User
∙ 11y ago
Add your answer:
Earn +20 pts
Why does hexane appear as more than one peak in gas chromatography?
Hexane is a mixture of 3 isomers out of a possible 5 isomers of 6 carbon alkanes. Normally there are 3 peaks for GC. Use a GC grade n-Hexane for one peak of the 'main' hexane.
What is a chemical of the hexane family?
Hexane is an alkane of six carbon atoms. There ar five different isomers with that particular structure.
Is C6H14 a cycloalkine?
No, it is a non-cyclic, saturated alkane called hexane of which 5 different isomers exsist
Is hexane a compound or mixture?
Hexane is a compound.
Does RNA have isomers?
Yes, RNA does have isomers.
What is the IUPAC name for butane?
Hexane is the chemical name for Hexane. However another name for Hexane is n-Hexane. Some different isomers of Hexane are: -2-Methylpentane (Isohexane) -3-Methylpentane -2,3-Dimethylbutane -2,2-Dimethylbutane (Neohexane) The chemical formula of Hexane is C6H14.
Are cyclohexane and n-hexane isomers of each other explain?
are cyclohenane and n-hexane isomers of each other?explain
What is difference between hexane and n-hexane?
Hexane is a hydrocarbon with the chemical formula C6H14. n-hexane is the unbranched isomer of hexane as there exists four more branched isomers of hexane
Why does hexane appear as more than one peak in gas chromatography?
Hexane is a mixture of 3 isomers out of a possible 5 isomers of 6 carbon alkanes. Normally there are 3 peaks for GC. Use a GC grade n-Hexane for one peak of the 'main' hexane.
What is a chemical of the hexane family?
Hexane is an alkane of six carbon atoms. There ar five different isomers with that particular structure.
Which pair of compounds are structural isomers of each other?
Hexane and 2-methylpentane
How many structural isomers exist for C6H14?
Well let me see... isomers are compounds which share the same moecular formula (ieC6H14) but have different structures. So isomers of hexane (c6h14) include: Hexane 2-Methylpentane 3-Methylpentane 2,3-Dimethylbutane 2,2-Dimethylbutane Hope this helps
What are the constitutional isomers of hexane CH3CH24CH3?
This formula is for n-hexane.The other four isomers are:- 2-methylpentane- 3-methylpentane- 2,2-dimethylbutane- 2,3-dimethylbutane
Is C6H14 a cycloalkine?
No, it is a non-cyclic, saturated alkane called hexane of which 5 different isomers exsist
Isomers of c6h14?
hexane, 2,2-dimethylbutane, 2,3-dimethylbutane, 2-methylpentane, 3-methylpentane, etc.
Is heptane the same as hexane?
Hexane is a hydrocarbon with the chemical formula C6H14. n-hexane is the unbranched isomer of hexane as there exists four more branched isomers of hexane
What are the structural isomers for C6H10?
1. hexane: CH3-CH2-CH2-CH2-CH2-CH32. 3-methylpentane: CH3-CH2-CH(CH3)-CH2-CH33. 2-methylpentane: CH3-CH(CH3)-CH2-CH2-CH34. 2,2-dimethylbutane: CH3-C(CH3(CH3))-CH2-CH3
