0
What else can I help you with?
What type of reaction is Al plus 3Hg(CH3)2 yields Al(CH3) plus 3Hg?
This reaction is called "metal-metal exchange reaction".
What is ch2 equals c-ch3-ch2-ch2-ch3?
The compound CH2=CH-CH=CH2 when reacts with HBr gives 1,4 addition product, CH3-CH=CH-CH2Br
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
Can you make two structural isomers from a saturated alkane C4H10?
n-butane CH3-CH2-CH2-CH3 and isobutane CH3-CH(CH3)-CH3
What is condensed formula for 2 3 3 4 tetramethylnonane?
The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.
What is the structure for c2h6o?
C2H6O could be 1) Ethanol, CH3CH2OH 2) Dimethyl ether, CH3OCH3
What is the shape bond angle and hybridization of plus CH3?
CH3 is a trigonal planar and has a hybridization of sp3
Is Al plus 3Hg(CH3)2 yields Al(CH3)3 plus 3Hg a precipitation reaction?
Trimethyl aluminium is not a solid precipitate.
What is the molecular geometry of CH3 plus?
Trigonal Planar
What is the electron geometry of CH3 plus?
Trigonal Planar
What type of reaction is Al plus 3Hg(CH3)2 yields Al(CH3) plus 3Hg?
This reaction is called "metal-metal exchange reaction".
What is ch2 equals c-ch3-ch2-ch2-ch3?
The compound CH2=CH-CH=CH2 when reacts with HBr gives 1,4 addition product, CH3-CH=CH-CH2Br
What is the reaction equation of 1-butene and water?
Ch2=ch-ch2-ch3 + h2 = ch3-ch2-ch2-ch3
What is the product of 2AgClO3 and Na2CO3?
The reaction between 2AgClO3 and Na2CO3 would produce Ag2CO3 (silver carbonate) and 2NaClO3 (sodium chlorate) as products.
Which species is formed when the CH3N2 plus cation loses a nitrogen molecule?
When the CH3N2+ cation loses a nitrogen molecule, it forms the species CH3+ (methyl cation). This process involves the elimination of a nitrogen molecule (N2) from the original cation, leaving behind the methyl cation as the final product. The methyl cation is a positively charged species with a molecular formula of CH3+, consisting of a carbon atom bonded to three hydrogen atoms.
What 2 4?
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
What’s 2×4?
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
