0
What else can I help you with?
What is the name of ch3-ch2-ch2-ch2-ch-ch3 with ch3 over the ch?
The compound CH3-CH2-CH2-CH2-CH(CH3)-CH3 is known as 2-hexyl. In this structure, there is a hexane backbone with a methyl group (CH3) attached to the second carbon. The presence of the substituent gives it the specific name based on IUPAC nomenclature.
What is the name of ch3-ch2-ch2-ch3 with single bondof ch3?
The molecule is called butane. It consists of four carbon atoms in a chain with each carbon having hydrogen atoms attached, including the end carbons which each have 3 hydrogens.
What is condensed formula for 2 3 3 4 tetramethylnonane?
The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.
What is the molecule ch3 ch2 ch2 o ch2 ch3?
The molecule is called ethyl ether, which has the chemical formula CH3CH2OCH2CH3. It is commonly used as a solvent and as a starting material in organic synthesis reactions. Ethyl ether is a volatile liquid with a sweet odor and is highly flammable.
What type of molecule is octanal?
Octanal - CH3(CH2)6CHO - is a type of aldehyde.
What is the name for this molecule ch3 ch2 ch3?
The molecule is called propane. It is a three-carbon alkane with the chemical formula C3H8.
What is the IUPAC name for CH3-CH2-CH2-CH2-Br?
1 - bromopropane is the IUPAC name for CH3-CH2-CH2-CH2-Br.
What is the name of ch3 ch2 ch2 ch3?
The name of the compound CH3CH2CH2CH3 is butane.
What is the name of ch3-ch2-ch2-ch2-ch-ch3 with ch3 over the ch?
The compound CH3-CH2-CH2-CH2-CH(CH3)-CH3 is known as 2-hexyl. In this structure, there is a hexane backbone with a methyl group (CH3) attached to the second carbon. The presence of the substituent gives it the specific name based on IUPAC nomenclature.
What is the name for compound CH2CH2CH3?
CH2CH2CH3 is NOT a compound name, but a 'Propyl' functional group , which would be attached to a larger molecule. Propane is CH3-CH2-CH3 Propene is CH2=CH-CH3 Propyne is HC=C-CH3 ( A triple bond). The CH2CH2CH2, is written as R-CH2CH2CH3 , the propyl functional group and 'R' the rest of the molecule.
What is the name of CH3-ch2 -ch2-o-ch2-ch2-ch3?
Cyclopentyl ethyl ester
What compound is CH3-CH2-CH-CH3-CH3?
It is a hydrocarbon: Butyl group. As it has 4 carbons it has prefix "but-" and it has general formula CnH2n+1 so it is part of Alkyl group. Accurately it is butyl group: CH3-CH2-CH2-CH2- Remember it has a bond protruding out from last CH2
What are the structural isomers for C6H10?
1. hexane: CH3-CH2-CH2-CH2-CH2-CH32. 3-methylpentane: CH3-CH2-CH(CH3)-CH2-CH33. 2-methylpentane: CH3-CH(CH3)-CH2-CH2-CH34. 2,2-dimethylbutane: CH3-C(CH3(CH3))-CH2-CH3
What is the reaction equation of 1-butene and water?
Ch2=ch-ch2-ch3 + h2 = ch3-ch2-ch2-ch3
What is the structure for octane?
Ch3-ch2-ch2-ch2-ch2-ch2-ch2-ch3
What is the iupac name for ch3 ch2 ch2 o ch3?
propyl-methyl ether
What is the iupac name for ch3-ch2-ch2-oh?
Pentanol
