0
CH2CH2CH3 is NOT a compound name, but a 'Propyl' functional group , which would be attached to a larger molecule.
Propane is CH3-CH2-CH3
Propene is CH2=CH-CH3
Propyne is HC=C-CH3 ( A triple bond).
The CH2CH2CH2, is written as R-CH2CH2CH3 , the propyl functional group and 'R' the rest of the molecule.
What else can I help you with?
What is the name compound ch3ch2och2h2ch3?
The compound CH3CH2OCH2H2CH3 is named ethyl propyl ether. It consists of an ethyl group (CH3CH2) connected to a propyl group (CH2CH2CH3) through an oxygen atom in the middle.
What is the formula for the propyl group?
The propyl group is a three-carbon alkyl group with the formula C3H7. It can be represented as -CH2CH2CH3.
What is the name of this compound Ch3Ch2-O-CH2CH2Ch3?
Ethyl propyl ether. The formula should be correctly written as CH3-CH2-O-CH2-CH2-CH3 Note the use of capitals, particularly for Hydrogen (H) , not 'h'.
What is the name of a compound with the structure CH3CH2CH2CH2CH2CO2CH2CH2CH3?
This is an impossible compound formula: at the 5th C there can be either ONE oxygen atom (-CO-) or 2 hydrogen atoms (-CH2-, not -CO2-);In those corrected cases the names would be eithern-nonanon-4: CH3CH2CH2CH2CH2C(O)CH2CH2CH3or n-nonaan : CH3CH2CH2CH2CH2C(H2)CH2CH2CH3
What is compound name for Sil4?
The compound name for SiI4 is tetrasilane.
What is the name of the compound ch3ch2ch2ch2ch2ch2ch2ch3?
dimethylamine
What is the name compound ch3ch2och2h2ch3?
The compound CH3CH2OCH2H2CH3 is named ethyl propyl ether. It consists of an ethyl group (CH3CH2) connected to a propyl group (CH2CH2CH3) through an oxygen atom in the middle.
What is the formula for the propyl group?
The propyl group is a three-carbon alkyl group with the formula C3H7. It can be represented as -CH2CH2CH3.
What is the name of this compound Ch3Ch2-O-CH2CH2Ch3?
Ethyl propyl ether. The formula should be correctly written as CH3-CH2-O-CH2-CH2-CH3 Note the use of capitals, particularly for Hydrogen (H) , not 'h'.
Is CH2CH2CH3 polar or nonpolar?
Bonds between carbon and hydrogen are non-polar.
What is the name of a compound with the structure CH3CH2CH2CH2CH2CO2CH2CH2CH3?
This is an impossible compound formula: at the 5th C there can be either ONE oxygen atom (-CO-) or 2 hydrogen atoms (-CH2-, not -CO2-);In those corrected cases the names would be eithern-nonanon-4: CH3CH2CH2CH2CH2C(O)CH2CH2CH3or n-nonaan : CH3CH2CH2CH2CH2C(H2)CH2CH2CH3
What is the name for the compound IF?
The name of this compound is iodine heptafluoride.
What is there compound name for 7H2O?
The compound name for 7H2O is heptahydrate.
What is compound name for Sil4?
The compound name for SiI4 is tetrasilane.
What is the name of the molecular compound N4Se4?
Tetranitrogen tetraselenide is the name of the compound.
What is the name of compound Cl2O3?
The name of the compound Cl2O3 is dichlorine trioxide.
What is compound name for MnBr2 NaPO4?
The compound name for MnBr2 is manganese(II) bromide and the compound name for NaPO4 is sodium phosphate.
