answersLogoWhite

0

This is an impossible compound formula: at the 5th C there can be either ONE oxygen atom (-CO-) or 2 hydrogen atoms (-CH2-, not -CO2-);

In those corrected cases the names would be either

  • n-nonanon-4: CH3CH2CH2CH2CH2C(O)CH2CH2CH3
or
  • n-nonaan : CH3CH2CH2CH2CH2C(H2)CH2CH2CH3
User Avatar

Wiki User

8y ago

What else can I help you with?

Related Questions

What is the organic name of ch3ch2ch2ch2ch2co2ch2ch2ch3?

Hexan-2-ol hex' because it's a 6 chain carbon and 2 because you choose the end to start from that gives you the smallest number. an 'ol'


What is the IUPAC name of a compound with the structure "structure to IUPAC name converter"?

The IUPAC name of a compound with the structure "structure to IUPAC name converter" is not provided as it is not a valid chemical structure. Please provide a specific chemical structure for accurate naming.


What is the systematic name of the following compound cuclo?

The systematic name of "cuclo" is not provided. If you provide the complete molecular structure, I can help you determine the systematic name of the compound.


If copper appears in the name of a compound in indicates that the compound comtains?

If copper appears in the name of a compound, it indicates that the compound contains copper as one of its constituent elements. The presence of "copper" in the compound's name signifies the inclusion of copper atoms within the chemical structure of the compound.


What is the compound name for CH3NO?

It is Methanamide with structure: H-(C=O)-NH2


What is the Lewis structure of the compound CCLO?

The Lewis structure of the compound CCLO is as follows: CCCl-O.


For which compound is a square used to represent its structure?

A square is used to represent the structure of a compound called benzene.


What is the purpose of the organic compound name generator?

The purpose of the organic compound name generator is to help chemists and students quickly and accurately generate systematic names for organic compounds based on their chemical structure.


What does the name hydrate indicate about its composition?

The name "hydrate" indicates that the compound contains water molecules attached to its structure. In hydrates, water molecules are typically loosely bound to the compound through hydrogen bonding. The water content can vary, but it is usually expressed as a ratio to the compound in the formula.


What is this compound name S2CI2?

The compound S2Cl2 is known as disulfur dichloride. It is a chemical compound made up of two sulfur atoms and two chlorine atoms, with a bent molecular structure.


What are different kinds of sentence according to structure?

Sentence according to structure are: simple, compound, complex and compound-complex.


What is the correct condensed structure for the compound provided?

Could you please provide the compound for which you would like the condensed structure?