0
What is the name of a compound with the structure CH3CH2CH2CH2CH2CO2CH2CH2CH3?
Wiki User
∙ 7y ago
This is an impossible compound formula: at the 5th C there can be either ONE oxygen atom (-CO-) or 2 hydrogen atoms (-CH2-, not -CO2-);
In those corrected cases the names would be either
- n-nonanon-4: CH3CH2CH2CH2CH2C(O)CH2CH2CH3
- n-nonaan : CH3CH2CH2CH2CH2C(H2)CH2CH2CH3
Wiki User
∙ 7y ago
Wiki User
∙ 7y agoThis is an ester (not a hydrocarbon). It is formed from hexanoic acid (CH3CH2CH2CH2CH2COOH) and propanol (CH3CH2CH2OH). The resulting compound would be called propyl hexanoate.
Add your answer:
Earn +20 pts
What is the name of the structure formed when atoms are joined by covalent bond?
covalent compound
Lewis dot structure for calcium phosphate?
Calcium phosphate is the chemical name for the molecular compound of the formula Ca3(PO4)2. The Lewis dot structure representing calcium phosphate is:
What term describes the arrangement of atoms within a molecule?
molecular structure
A compound will have a covalent structure if it is made from?
An alkali metal
What kind of structure does an ionic compound have?
crystal compounds
What is the name of the structure formed when atoms are joined by covalent bond?
covalent compound
What is the compound name for CH3NO?
It is Methanamide with structure: H-(C=O)-NH2
Is it possible to trap a resonance structure of a compound for study?
No, the structure of the compound shifts back and forth from one resonance structure to the other rapidly.
What are different kinds of sentence according to structure?
Sentence according to structure are: simple, compound, complex and compound-complex.
How do you find how many atoms of an element are in a compound if you are only given the name and not the formula?
Draw the structure based on the name. Then count the number of times each atom appears in the structure. Alternately, you can determine the formula from the structure - and then count all atoms of each type.
Lewis dot structure for calcium phosphate?
Calcium phosphate is the chemical name for the molecular compound of the formula Ca3(PO4)2. The Lewis dot structure representing calcium phosphate is:
What is the chemical structure compound for Demerol?
c6h5cc5Nch3cooch2ch3
Is the chemical name and compound name the same for BaCl2.2H2O?
It's barium chloride, and the 2 water molecules are the water of crystallization necessary to form a crystal lattice structure.
What term describes the arrangement of atoms within a molecule?
molecular structure
Is caffeine a element or a compound?
Caffeine is a compound with the chemical formula C8H10N4O2.
How does the structure of a compound affect which solvent it dissolves in?
Amani
What is the meaning of compound according to structure?
it has ah gago
