0
What else can I help you with?
What is the name of CH3-ch2 -ch2-o-ch2-ch2-ch3?
Cyclopentyl ethyl ester
What is the reaction equation of 1-butene and water?
Ch2=ch-ch2-ch3 + h2 = ch3-ch2-ch2-ch3
What is the iupac name for ch3 ch2 ch2 o ch3?
propyl-methyl ether
What is the compound name of O-CH2-CH3?
The compound name of O-CH2-CH3 is ethyl methoxide.
What is the IUPAC name for ch3-ch equals ch-ch3?
The compound Cl-CH2-CH2-CH2-CH=CH-CH2-Br is 1-bromo-6-chloro-2-hexene.
What is the IUPAC name for CH3-CH2-CH2-CH2-Br?
1 - bromopropane is the IUPAC name for CH3-CH2-CH2-CH2-Br.
What is the name of ch3-ch2-ch2-ch2-ch-ch3 with ch3 over the ch?
The compound CH3-CH2-CH2-CH2-CH(CH3)-CH3 is known as 2-hexyl. In this structure, there is a hexane backbone with a methyl group (CH3) attached to the second carbon. The presence of the substituent gives it the specific name based on IUPAC nomenclature.
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
What is the name of CH3-ch2 -ch2-o-ch2-ch2-ch3?
Cyclopentyl ethyl ester
What is the structure for octane?
Ch3-ch2-ch2-ch2-ch2-ch2-ch2-ch3
What is the reaction equation of 1-butene and water?
Ch2=ch-ch2-ch3 + h2 = ch3-ch2-ch2-ch3
What is the iupac name for ch3 ch2 ch2 o ch3?
propyl-methyl ether
What is the iupac name for ch3-ch2-ch2-oh?
Pentanol
What is condensed formula for 2 3 3 4 tetramethylnonane?
The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.
What is the name for CH3 CH2?
pentane
What is the compound name of O-CH2-CH3?
The compound name of O-CH2-CH3 is ethyl methoxide.
What is the IUPAC name of CH33C2?
(CH3-CH2)3-C-CH2-CH2-CH2-CH2-C-(CH3)3 It is 7,7-diethyl-2,2-dimethylnonane
