0
What else can I help you with?
Continue Learning about Chemistry
What is the name of CH3-ch2 -ch2-o-ch2-ch2-ch3?
Cyclopentyl ethyl ester
What is the reaction equation of 1-butene and water?
Ch2=ch-ch2-ch3 + h2 = ch3-ch2-ch2-ch3
What is the iupac name for ch3 ch2 ch2 o ch3?
propyl-methyl ether
What is the compound name of O-CH2-CH3?
The compound name of O-CH2-CH3 is ethyl methoxide.
What is the IUPAC name for ch3-ch equals ch-ch3?
The compound Cl-CH2-CH2-CH2-CH=CH-CH2-Br is 1-bromo-6-chloro-2-hexene.
Related Questions
What is the IUPAC name for CH3-CH2-CH2-CH2-Br?
1 - bromopropane is the IUPAC name for CH3-CH2-CH2-CH2-Br.
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
What is the name of CH3-ch2 -ch2-o-ch2-ch2-ch3?
Cyclopentyl ethyl ester
What is the structure for octane?
Ch3-ch2-ch2-ch2-ch2-ch2-ch2-ch3
What is the reaction equation of 1-butene and water?
Ch2=ch-ch2-ch3 + h2 = ch3-ch2-ch2-ch3
What is the iupac name for ch3 ch2 ch2 o ch3?
propyl-methyl ether
What is the iupac name for ch3-ch2-ch2-oh?
Pentanol
What is condensed formula for 2 3 3 4 tetramethylnonane?
The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.
What is the name for CH3 CH2?
pentane
What is the compound name of O-CH2-CH3?
The compound name of O-CH2-CH3 is ethyl methoxide.
What is the IUPAC name of CH33C2?
(CH3-CH2)3-C-CH2-CH2-CH2-CH2-C-(CH3)3 It is 7,7-diethyl-2,2-dimethylnonane
What is the nomenclature name for ch3-ch2-chch-ch2-ch2-ch2-ch3?
oct-3-ene (IUPAC)8 carbonsone double-bond on the third carbonno branches
Trending Questions
Name tow example of crbohydrates?
What is the mass number or neon?
Why is aluminium positioned in group 3?
Why doas tide claim to be the best laundry detergent?
What is fluorines density?
What are the 3 states matter could exist in?
How does a chimney work using convenction?
Do metal keep drinks cold?
Does maize contain starch?
Can you buy 96 percent alcohol?
How many compounds are in H2O?
Does metal contain cobalt?
What do the initials PIASM stand for in the particle theory?
What elements are in peanuts?
How do you draw the electronic energy level diagram for sulfur with a -2 charge?
What is the centigrade of 77 degrees Fahrenheit?
How many electrons does silver have to gave up in order to achieve a pseudo-noble-gas electron configuration?
How many different compounds are there in crude oil?
A beta particle is actually what?
Is coffee a base?
Copyright ©2025 Answers.com | Lunias Media Inc. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.