0
pentane
What else can I help you with?
Related Questions
What is the IUPAC name for CH3-CH2-CH2-CH2-Br?
1 - bromopropane is the IUPAC name for CH3-CH2-CH2-CH2-Br.
What is the name of ch3 ch2 ch2 ch3?
The name of the compound CH3CH2CH2CH3 is butane.
What is the name of ch3-ch2-ch2-ch2-ch-ch3 with ch3 over the ch?
The compound CH3-CH2-CH2-CH2-CH(CH3)-CH3 is known as 2-hexyl. In this structure, there is a hexane backbone with a methyl group (CH3) attached to the second carbon. The presence of the substituent gives it the specific name based on IUPAC nomenclature.
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
What is the name of CH3-ch2 -ch2-o-ch2-ch2-ch3?
Cyclopentyl ethyl ester
What is the reaction equation of 1-butene and water?
Ch2=ch-ch2-ch3 + h2 = ch3-ch2-ch2-ch3
What is the structure for octane?
Ch3-ch2-ch2-ch2-ch2-ch2-ch2-ch3
What is the iupac name for ch3 ch2 ch2 o ch3?
propyl-methyl ether
What is the iupac name for ch3-ch2-ch2-oh?
Pentanol
What is condensed formula for 2 3 3 4 tetramethylnonane?
The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.
What is the compound name of O-CH2-CH3?
The compound name of O-CH2-CH3 is ethyl methoxide.
What is the IUPAC name of CH33C2?
(CH3-CH2)3-C-CH2-CH2-CH2-CH2-C-(CH3)3 It is 7,7-diethyl-2,2-dimethylnonane
Trending Questions
What countries were in the triple alliance in world war 1 in 1914?
What is another name for Lucky but for a girl?
Is it ok to give money to boyfriend on birthday after 6 months of dating?
How do calendars help us with daily lives?
Whose picture on dollar?
What does tintable mean in painting?
When did Burey Bhi Hum Bhale Bhi Hum end?
Do you say past experiences or passed experiences?
What are the factors affecting physical education?
Do acids react with oxygen?
What is YEE90 mean in the airline codes?
Who is Danielle the nail girl from tyler perry's house of Payne?
What animals lived in New Zealand?
What is the climax of phaethon?
Do kids get candy on day of the dead?
Does Trinidad have a gps system?
How do you get 7 using 4 fours?
Did the Iroquois hunt black bear?
What is the plural for the name cross?
Which shape has 5 lines of symmetry?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.