0
pentane
What else can I help you with?
Related Questions
What is the IUPAC name for CH3-CH2-CH2-CH2-Br?
1 - bromopropane is the IUPAC name for CH3-CH2-CH2-CH2-Br.
What is the name of ch3 ch2 ch2 ch3?
The name of the compound CH3CH2CH2CH3 is butane.
What is the name of ch3-ch2-ch2-ch2-ch-ch3 with ch3 over the ch?
The compound CH3-CH2-CH2-CH2-CH(CH3)-CH3 is known as 2-hexyl. In this structure, there is a hexane backbone with a methyl group (CH3) attached to the second carbon. The presence of the substituent gives it the specific name based on IUPAC nomenclature.
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
What is the name of CH3-ch2 -ch2-o-ch2-ch2-ch3?
Cyclopentyl ethyl ester
What is the reaction equation of 1-butene and water?
Ch2=ch-ch2-ch3 + h2 = ch3-ch2-ch2-ch3
What is the structure for octane?
Ch3-ch2-ch2-ch2-ch2-ch2-ch2-ch3
What is the iupac name for ch3 ch2 ch2 o ch3?
propyl-methyl ether
What is the iupac name for ch3-ch2-ch2-oh?
Pentanol
What is condensed formula for 2 3 3 4 tetramethylnonane?
The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.
What is the compound name of O-CH2-CH3?
The compound name of O-CH2-CH3 is ethyl methoxide.
What is the IUPAC name of CH33C2?
(CH3-CH2)3-C-CH2-CH2-CH2-CH2-C-(CH3)3 It is 7,7-diethyl-2,2-dimethylnonane
Trending Questions
Just like a RTG player in NCAA to Madden. Can you import an NCAA character to NBA 2K11?
What is Marc Gasol famous for?
Is cream for your body good for you?
What did laissez-faire supporters believe about the government?
Who are Jim hensons partners?
What organisms have ribosomes?
Where can one find the meaning of traffic signals online?
What actors and actresses appeared in Le jeune homme et le lion - 1976?
How can I find out how to get a bondsman for my situation?
Can you get money by giving tours in club penguin?
What is 4.012 in expanded form?
How do you discard a card in wizard 101?
What numbers between 61 and 107 are multiples of 2 6 8?
How do you spell horsesss?
Why does cat's voice off of victorious weird?
What has 10 tenticals?
How do you adjust the pressure on a rear window wiper blade on a 06 Chevy trailblazer?
What army used a machine gun in World War 1?
What is cefuroxime axetil proscribed for?
What does trench look like?
Copyright ©2025 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.