0
pentane
What else can I help you with?
Related Questions
What is the IUPAC name for CH3-CH2-CH2-CH2-Br?
1 - bromopropane is the IUPAC name for CH3-CH2-CH2-CH2-Br.
What is the name of ch3 ch2 ch2 ch3?
The name of the compound CH3CH2CH2CH3 is butane.
What is the name of ch3-ch2-ch2-ch2-ch-ch3 with ch3 over the ch?
The compound CH3-CH2-CH2-CH2-CH(CH3)-CH3 is known as 2-hexyl. In this structure, there is a hexane backbone with a methyl group (CH3) attached to the second carbon. The presence of the substituent gives it the specific name based on IUPAC nomenclature.
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
What is the name of CH3-ch2 -ch2-o-ch2-ch2-ch3?
Cyclopentyl ethyl ester
What is the reaction equation of 1-butene and water?
Ch2=ch-ch2-ch3 + h2 = ch3-ch2-ch2-ch3
What is the structure for octane?
Ch3-ch2-ch2-ch2-ch2-ch2-ch2-ch3
What is the iupac name for ch3 ch2 ch2 o ch3?
propyl-methyl ether
What is the iupac name for ch3-ch2-ch2-oh?
Pentanol
What is condensed formula for 2 3 3 4 tetramethylnonane?
The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.
What is the compound name of O-CH2-CH3?
The compound name of O-CH2-CH3 is ethyl methoxide.
What is the IUPAC name of CH33C2?
(CH3-CH2)3-C-CH2-CH2-CH2-CH2-C-(CH3)3 It is 7,7-diethyl-2,2-dimethylnonane
Trending Questions
What is the next number in the sequence 18 24 31 24 30?
How did a consumer culture develop in 1950s American society?
How much does it cost to swim at woolston?
When did Charles Paul Alexander die?
What words can describe the feeling of snow?
Is 572 a prime or composite?
How many minutes is in 2 how many minutes are in 2 hours and 30 minutes?
What happened 87 years before 1863?
How many sides to a scalene triangle?
Are chameleons green?
Formula for calculating rebar mass per kg?
Is jeanne cooper from young and the restless sick?
What time does academy store arlingtontx open Sunday?
What is 5.6 ft in inches?
What reflects a general sense of happiness and satisfaction with your life?
What are the raw materials used in jet engine?
How can some speculative risks have an insurable element?
Negative plus a negative positive?
What is the purpose of an image with text?
2003 Ford Expedition 5.4L Where is the fuse that regulates the battery light in the console?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.