0
pentane
What else can I help you with?
Related Questions
What is the IUPAC name for CH3-CH2-CH2-CH2-Br?
1 - bromopropane is the IUPAC name for CH3-CH2-CH2-CH2-Br.
What is the name of ch3 ch2 ch2 ch3?
The name of the compound CH3CH2CH2CH3 is butane.
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
What is the name of CH3-ch2 -ch2-o-ch2-ch2-ch3?
Cyclopentyl ethyl ester
What is the structure for octane?
Ch3-ch2-ch2-ch2-ch2-ch2-ch2-ch3
What is the reaction equation of 1-butene and water?
Ch2=ch-ch2-ch3 + h2 = ch3-ch2-ch2-ch3
What is the iupac name for ch3 ch2 ch2 o ch3?
propyl-methyl ether
What is the iupac name for ch3-ch2-ch2-oh?
Pentanol
What is condensed formula for 2 3 3 4 tetramethylnonane?
The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.
What is the compound name of O-CH2-CH3?
The compound name of O-CH2-CH3 is ethyl methoxide.
What is the IUPAC name of CH33C2?
(CH3-CH2)3-C-CH2-CH2-CH2-CH2-C-(CH3)3 It is 7,7-diethyl-2,2-dimethylnonane
What is the nomenclature name for ch3-ch2-chch-ch2-ch2-ch2-ch3?
oct-3-ene (IUPAC)8 carbonsone double-bond on the third carbonno branches
Trending Questions
Are top and park bom dating?
Why is it significant that paul holden accept darry's challenge?
How many guppies can you have 2 angelfish and more fish?
What are the 2 rivers in Christchurch called?
What are the formatting used for the newsletter in a word processor?
What does fit mean on a guy?
What are considered long bones?
What does mis-sold mean?
What is the mood of the Moon in Aquarius?
What is 79 minus 39?
How do you convert 1 lb into cups?
What is a piece of land surrounded by land on 3 sides?
What are little molehill type mounds with a hole down the middle?
Why is Shove Tuesday celebrated before Ash Wednesday?
How do you say goodnight little baby in spanish?
About how long does a cumulus cloud last?
You have 2 coins that total 55p one of them is not a 5pence coin what are the 2 coins?
What is the cornerstone of leadership in USMC?
What is a full form of BBC?
Could the barbarians could have stopped the barbarian invasions?
Copyright ©2025 Answers.com. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.