answersLogoWhite

0

What is the name for CH3 CH2?

User Avatar

Anonymous

∙ 13y ago
Updated: 2/19/2023

pentane

User Avatar

Kip Strosin ∙

Lvl 13
∙ 2y ago
Copy

What else can I help you with?

Related Questions

What is the IUPAC name for CH3-CH2-CH2-CH2-Br?

1 - bromopropane is the IUPAC name for CH3-CH2-CH2-CH2-Br.


What is the name of ch3 ch2 ch2 ch3?

The name of the compound CH3CH2CH2CH3 is butane.


What is the name of ch3-ch2-ch2-ch2-ch-ch3 with ch3 over the ch?

The compound CH3-CH2-CH2-CH2-CH(CH3)-CH3 is known as 2-hexyl. In this structure, there is a hexane backbone with a methyl group (CH3) attached to the second carbon. The presence of the substituent gives it the specific name based on IUPAC nomenclature.


How do you name this molecule ch3 ch2 ch3?

CH3-CH2-CH3 is a gas Propane.


What is the name of CH3-ch2 -ch2-o-ch2-ch2-ch3?

Cyclopentyl ethyl ester


What is the reaction equation of 1-butene and water?

Ch2=ch-ch2-ch3 + h2 = ch3-ch2-ch2-ch3


What is the structure for octane?

Ch3-ch2-ch2-ch2-ch2-ch2-ch2-ch3


What is the iupac name for ch3 ch2 ch2 o ch3?

propyl-methyl ether


What is the iupac name for ch3-ch2-ch2-oh?

Pentanol


What is condensed formula for 2 3 3 4 tetramethylnonane?

The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.


What is the compound name of O-CH2-CH3?

The compound name of O-CH2-CH3 is ethyl methoxide.


What is the IUPAC name of CH33C2?

(CH3-CH2)3-C-CH2-CH2-CH2-CH2-C-(CH3)3 It is 7,7-diethyl-2,2-dimethylnonane

Trending Questions
Is it appropriate to drape a red sash on the cross? What is the difference in adverb and adjective? Why do people care so much about athlete's foot? Can you get fingerprints off cling flim? Have pigeons webbed feet? How can spray paint and wall paint be removed from a large surface area of cement if pressure wash and graffiti remover did not work? What is 42 divided by 15? What was ww1 called during the time of the war? What is a good topic sentence for a gibbons monkey animal report? How would you describe a shirt in a way that captures its style, fit, and overall appearance? Could 35 ever be the product of 10 and another number Explain? The primary advantages of using JOIN ON is? What US city has the largest Italian population? What does my name mean and What does your name mean? Which word best completes the sentence The doctor and talked for quite some time? Where is the crankshaft sensor located on a 05 impala? Narcissistic wife want custody? What does it mean to be burnt at stake? What are the inventions of Jose rizal? How do you switch back to the old AOL homepage from the new one?

Resources

Leaderboard All Tags Unanswered

Top Categories

Algebra Chemistry Biology World History English Language Arts Psychology Computer Science Economics

Product

Community Guidelines Honor Code Flashcard Maker Study Guides Math Solver FAQ

Company

About Us Contact Us Terms of Service Privacy Policy Disclaimer Cookie Policy IP Issues
Answers Logo
Copyright ©2025 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.