0
What else can I help you with?
Related Questions
What is the IUPAC name for CH3-CH2-CH2-CH2-Br?
1 - bromopropane is the IUPAC name for CH3-CH2-CH2-CH2-Br.
What is the name of ch3 ch2 ch2 ch3?
The name of the compound CH3CH2CH2CH3 is butane.
What is the name of ch3-ch2-ch2-ch2-ch-ch3 with ch3 over the ch?
The compound CH3-CH2-CH2-CH2-CH(CH3)-CH3 is known as 2-hexyl. In this structure, there is a hexane backbone with a methyl group (CH3) attached to the second carbon. The presence of the substituent gives it the specific name based on IUPAC nomenclature.
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
What is the name of CH3-ch2 -ch2-o-ch2-ch2-ch3?
Cyclopentyl ethyl ester
What is the reaction equation of 1-butene and water?
Ch2=ch-ch2-ch3 + h2 = ch3-ch2-ch2-ch3
What is the structure for octane?
Ch3-ch2-ch2-ch2-ch2-ch2-ch2-ch3
What is the iupac name for ch3 ch2 ch2 o ch3?
propyl-methyl ether
What is the iupac name for ch3-ch2-ch2-oh?
Pentanol
What is condensed formula for 2 3 3 4 tetramethylnonane?
The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.
What is the compound name of O-CH2-CH3?
The compound name of O-CH2-CH3 is ethyl methoxide.
What is the IUPAC name of CH33C2?
(CH3-CH2)3-C-CH2-CH2-CH2-CH2-C-(CH3)3 It is 7,7-diethyl-2,2-dimethylnonane
Trending Questions
How do you spell a breathing noise?
What is the name of a recess in a church which a crucifix is kept?
Why is the front end of my 2003 Lincoln Aviator grinding and sqeaking...metal on metal sound...and jerking the steering wheel when I drive?
What is the holding area for the blood and also has a function in the immune system?
How was magic originally spelled?
What is the present perfect tense of rain?
When and where did baseball player Derek Aucoin play?
What do you call a rectangle box?
How often are meteorologists correct at predicting the weather?
Where is the Love city located?
What are three things the explorers were hoping to find?
Is a trapazoid a parallogram?
This 1967 movie put the issue of race relations at the forefront of its message?
Is The bulkhead partition between the engine and passenger compartments is designed to prevent compartment to compartment fire travel.?
Why is According to the SMCR model problems in communication can arise when the speaker fails to do what?
Why did baptist minister to visit Emily in A Rose for Emily?
What food group does cupcake mix come from?
How do you find the maximum interior height of a shed that is 10'W x 8'L and occupies 440 cu. ft. Assume that the angle at the apex of the roof is 120 degrees.?
What is x in the equation 5 to the power of x equals 5000?
How can one determine liabilities by comparing assets and net worth?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.