pentane
1 - bromopropane is the IUPAC name for CH3-CH2-CH2-CH2-Br.
The name of the compound CH3CH2CH2CH3 is butane.
The compound CH3-CH2-CH2-CH2-CH(CH3)-CH3 is known as 2-hexyl. In this structure, there is a hexane backbone with a methyl group (CH3) attached to the second carbon. The presence of the substituent gives it the specific name based on IUPAC nomenclature.
CH3-CH2-CH3 is a gas Propane.
Cyclopentyl ethyl ester
Ch3-ch2-ch2-ch2-ch2-ch2-ch2-ch3
Ch2=ch-ch2-ch3 + h2 = ch3-ch2-ch2-ch3
propyl-methyl ether
Pentanol
The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.
The compound name of O-CH2-CH3 is ethyl methoxide.
(CH3-CH2)3-C-CH2-CH2-CH2-CH2-C-(CH3)3 It is 7,7-diethyl-2,2-dimethylnonane