0
pentane
What else can I help you with?
Related Questions
What is the IUPAC name for CH3-CH2-CH2-CH2-Br?
1 - bromopropane is the IUPAC name for CH3-CH2-CH2-CH2-Br.
What is the name of ch3 ch2 ch2 ch3?
The name of the compound CH3CH2CH2CH3 is butane.
What is the name of ch3-ch2-ch2-ch2-ch-ch3 with ch3 over the ch?
The compound CH3-CH2-CH2-CH2-CH(CH3)-CH3 is known as 2-hexyl. In this structure, there is a hexane backbone with a methyl group (CH3) attached to the second carbon. The presence of the substituent gives it the specific name based on IUPAC nomenclature.
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
What is the name of CH3-ch2 -ch2-o-ch2-ch2-ch3?
Cyclopentyl ethyl ester
What is the reaction equation of 1-butene and water?
Ch2=ch-ch2-ch3 + h2 = ch3-ch2-ch2-ch3
What is the structure for octane?
Ch3-ch2-ch2-ch2-ch2-ch2-ch2-ch3
What is the iupac name for ch3 ch2 ch2 o ch3?
propyl-methyl ether
What is the iupac name for ch3-ch2-ch2-oh?
Pentanol
What is condensed formula for 2 3 3 4 tetramethylnonane?
The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.
What is the compound name of O-CH2-CH3?
The compound name of O-CH2-CH3 is ethyl methoxide.
What is the IUPAC name of CH33C2?
(CH3-CH2)3-C-CH2-CH2-CH2-CH2-C-(CH3)3 It is 7,7-diethyl-2,2-dimethylnonane
Trending Questions
What links timithy small and Jeremy irons?
What is the reciprocal of 1x?
Which planet has a similar length of day as Earth?
HOW DID YOU KNOW THAT JERF HAR IS NOT A STREET IN NEW YORK?
What is 15 percent off of 19.71?
How many prepositional phrases are in every year in spring we plant wildflowers seeds in my mother's garden?
If you are waiting for adjudication does that mean all paperwork is in?
Where did david almond get the name mina from?
Why do golf mk4 engines rev up and down when its stood still?
What conditions contribute to backdraft?
How can you tell which ip addresses are network addresses?
How many brothers and sisters do Kerry Washington have?
Does bajraha surname come in rajput cast?
What keeps impact sockets from rusting?
What a credit score of 602 mean?
How do you increase the range of a thermometer?
What are the recent fads and why do people lose interest?
Can you use a kicker to install carpet?
What day was Noah Cyrus born?
Why is marseille important?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.