0
pentane
What else can I help you with?
Related Questions
What is the IUPAC name for CH3-CH2-CH2-CH2-Br?
1 - bromopropane is the IUPAC name for CH3-CH2-CH2-CH2-Br.
What is the name of ch3 ch2 ch2 ch3?
The name of the compound CH3CH2CH2CH3 is butane.
What is the name of ch3-ch2-ch2-ch2-ch-ch3 with ch3 over the ch?
The compound CH3-CH2-CH2-CH2-CH(CH3)-CH3 is known as 2-hexyl. In this structure, there is a hexane backbone with a methyl group (CH3) attached to the second carbon. The presence of the substituent gives it the specific name based on IUPAC nomenclature.
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
What is the name of CH3-ch2 -ch2-o-ch2-ch2-ch3?
Cyclopentyl ethyl ester
What is the reaction equation of 1-butene and water?
Ch2=ch-ch2-ch3 + h2 = ch3-ch2-ch2-ch3
What is the structure for octane?
Ch3-ch2-ch2-ch2-ch2-ch2-ch2-ch3
What is the iupac name for ch3 ch2 ch2 o ch3?
propyl-methyl ether
What is the iupac name for ch3-ch2-ch2-oh?
Pentanol
What is condensed formula for 2 3 3 4 tetramethylnonane?
The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.
What is the compound name of O-CH2-CH3?
The compound name of O-CH2-CH3 is ethyl methoxide.
What is the IUPAC name of CH33C2?
(CH3-CH2)3-C-CH2-CH2-CH2-CH2-C-(CH3)3 It is 7,7-diethyl-2,2-dimethylnonane
Trending Questions
What is the recursive definition for the sequence 38 30.5 23 15.5 8?
How does a camcorder work?
How many national holidays are in Japan?
What devices are both input and output?
Which hip hop artist influenced marshall Bruce mathers?
What is the age limit in cinema for frozen?
Will morphine help with Dilaudid withdrawl?
What is the right to adequate legal assistance?
What is the phone number of the Ard Godfrey House in Minneapolis Minnesota?
When was Danica Acimac born?
Why do historians refer to this area as middle east instead of southwest Asia?
What are the Natural Features of Haiti?
What is the strongest attack of pikachu?
Why does the entropy of an isolated system never decrease?
What does the term 'bloop' mean when defined by the NOAA?
There are 100m in a kilometer?
What is a person called who do Autobody?
What does 'no lost time or lost time AW 107' mean on discharge papers?
What is the value of a Nolan Ryan 6th No-Hitter bat?
How do you use a hearth?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.