0
pentane
What else can I help you with?
Related Questions
What is the IUPAC name for CH3-CH2-CH2-CH2-Br?
1 - bromopropane is the IUPAC name for CH3-CH2-CH2-CH2-Br.
What is the name of ch3 ch2 ch2 ch3?
The name of the compound CH3CH2CH2CH3 is butane.
What is the name of ch3-ch2-ch2-ch2-ch-ch3 with ch3 over the ch?
The compound CH3-CH2-CH2-CH2-CH(CH3)-CH3 is known as 2-hexyl. In this structure, there is a hexane backbone with a methyl group (CH3) attached to the second carbon. The presence of the substituent gives it the specific name based on IUPAC nomenclature.
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
What is the name of CH3-ch2 -ch2-o-ch2-ch2-ch3?
Cyclopentyl ethyl ester
What is the reaction equation of 1-butene and water?
Ch2=ch-ch2-ch3 + h2 = ch3-ch2-ch2-ch3
What is the structure for octane?
Ch3-ch2-ch2-ch2-ch2-ch2-ch2-ch3
What is the iupac name for ch3 ch2 ch2 o ch3?
propyl-methyl ether
What is the iupac name for ch3-ch2-ch2-oh?
Pentanol
What is condensed formula for 2 3 3 4 tetramethylnonane?
The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.
What is the compound name of O-CH2-CH3?
The compound name of O-CH2-CH3 is ethyl methoxide.
What is the IUPAC name of CH33C2?
(CH3-CH2)3-C-CH2-CH2-CH2-CH2-C-(CH3)3 It is 7,7-diethyl-2,2-dimethylnonane
Trending Questions
How do you measure the hygroscopic of the any material?
What is the best hot dog to sell in a hot dog cart?
How long does it take to thaw ground beef?
What is a modem pool?
What is the value of an Iver Johnson cattleman 44 mag 34872?
What were the fielding stats for baseball player Craig Anderson playing at pitcher for the New York Mets in 1962?
What are the duties of a missionary in the pentecostal church?
When was Frans Anatolius Sjöström born?
Tim Burton originally wanted Sammy Davis Jr to play what role which eventually went to Michael Keaton?
What were sandbags used for?
What is a strange lumpy growth on your guinea pig's right back foot on his third toe?
How many seconds does a player have shoot or pass the ball in handball?
Where is the model number located on a 357 magnum smith weston?
When case status says adjudicated why isn't it closed?
What country was pitbull born in?
What are four discoveries of Gupta astronomers that we still hold true today?
Which is more popular a cat or a dog?
Can a sentence be started with While?
How many oz is in 5 gallon bucket liquid detergent?
What is meant by Kpf in capacitors?
Copyright ©2025 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.