0
pentane
What else can I help you with?
Related Questions
What is the IUPAC name for CH3-CH2-CH2-CH2-Br?
1 - bromopropane is the IUPAC name for CH3-CH2-CH2-CH2-Br.
What is the name of ch3 ch2 ch2 ch3?
The name of the compound CH3CH2CH2CH3 is butane.
What is the name of ch3-ch2-ch2-ch2-ch-ch3 with ch3 over the ch?
The compound CH3-CH2-CH2-CH2-CH(CH3)-CH3 is known as 2-hexyl. In this structure, there is a hexane backbone with a methyl group (CH3) attached to the second carbon. The presence of the substituent gives it the specific name based on IUPAC nomenclature.
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
What is the name of CH3-ch2 -ch2-o-ch2-ch2-ch3?
Cyclopentyl ethyl ester
What is the reaction equation of 1-butene and water?
Ch2=ch-ch2-ch3 + h2 = ch3-ch2-ch2-ch3
What is the structure for octane?
Ch3-ch2-ch2-ch2-ch2-ch2-ch2-ch3
What is the iupac name for ch3 ch2 ch2 o ch3?
propyl-methyl ether
What is the iupac name for ch3-ch2-ch2-oh?
Pentanol
What is condensed formula for 2 3 3 4 tetramethylnonane?
The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.
What is the compound name of O-CH2-CH3?
The compound name of O-CH2-CH3 is ethyl methoxide.
What is the IUPAC name of CH33C2?
(CH3-CH2)3-C-CH2-CH2-CH2-CH2-C-(CH3)3 It is 7,7-diethyl-2,2-dimethylnonane
Trending Questions
Does the concept of alma mater apply to graduate school?
What do Lebanese produce?
What are the areas that deals with Quantity Survey?
How long is the average person's mouth?
What is the hardness required for chain sprocket?
What is technical content writing?
The solution that emerged in the Missouri compromise was to admit Missouri as?
What goes better with dark purple light pink or orange?
Is the function f(x) x2 - 4 a linear function?
What does Brazil export?
How many electrons are in a aluminium atom?
What do you get when two strawberries meet?
Where can you get a DSI Action Replay MicroSD card at?
What is the living part of an esosystem?
A method of telling 2 different types of eubacteria apart by using dyes is called?
What is an NFL salary?
Is CuCl2 a strong electrolyte?
When was Katie Bode born?
When an open-top or flatbed vehicle is used to transport A and E material the load must be covered by a tarpaulin. Which statement is a requirement of the tarpaulin?
What to groups were expelled Spain and Portugal in the 1490s?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.