0
What else can I help you with?
What is the name of compound CH3 3?
The compound CH3 is known as methyl group. It is a functional group consisting of a carbon atom bonded to three hydrogen atoms.
Explain Why a reaction is exothermic or endothermic because of bond energies?
the reaction is OH ç CH3 CH = CH CH2 CH3 + 2 H2O ® CH3 CH CH CH2 CH3 ç OH
What is the name of this compound ch3-ch -ch2-ch2-cl There is CL on top of CH?
The name of this compound is 2-chlorobutane.
How much isomers does c5h10 have?
yes it have two isomer CH3.CH2.CH=CH-CH3, and CH3-CH=C-CH3 ! CH3 BY ATIF JUTT
What is ch2 equals c-ch3-ch2-ch2-ch3?
The compound CH2=CH-CH=CH2 when reacts with HBr gives 1,4 addition product, CH3-CH=CH-CH2Br
What is the name for the CH3-Ch-CH3 alkyl group?
The name for the CH3-Ch-CH3 alkyl group is isopropyl.
What is the name for the ch3-ch-ch3?
1-pentanol
What is the IUPAC name for ch3-ch equals ch-ch3?
The compound Cl-CH2-CH2-CH2-CH=CH-CH2-Br is 1-bromo-6-chloro-2-hexene.
What is the name for ch3chch3chch3ch3?
The name for CH3CH(CH3)CH(CH3)CH3 is 2,3-dimethylpentane.
What is the IUPAC name for CH2 equals CH-O-CH3?
The IUPAC name for CH2=CH-O-CH3 is ethenyl methoxymethane.
What is the structure of 2-pentanone?
CH3-CH(=O)-CH(CH3)-CH2-CH3
What is the name of compound CH3 3?
The compound CH3 is known as methyl group. It is a functional group consisting of a carbon atom bonded to three hydrogen atoms.
Explain Why a reaction is exothermic or endothermic because of bond energies?
the reaction is OH ç CH3 CH = CH CH2 CH3 + 2 H2O ® CH3 CH CH CH2 CH3 ç OH
What is the condensed formula for 223trimethylpentane?
The condensed formula for 2,2,3-trimethylpentane is CH₃C(CH₃)₂CH(CH₃)₂CH₃.
What is the correct structure of 3-ethyl-3-methylhexane?
The correct structure of 3-ethyl-3-methylhexane is: CH3-CH2-CH(CH3)-CH2-CH(CH3)-CH3
What is the name of this compound ch3-ch -ch2-ch2-cl There is CL on top of CH?
The name of this compound is 2-chlorobutane.
How much isomers does c5h10 have?
yes it have two isomer CH3.CH2.CH=CH-CH3, and CH3-CH=C-CH3 ! CH3 BY ATIF JUTT
