answersLogoWhite

0

2,2,3- trimethyl pentane has the structural shape.

CH3-C(CH3)2-CH(CH3)-CH2-CH3

C8H18 is the condensed /reduced formula.

User Avatar

lenpollock

Lvl 17
1y ago

What else can I help you with?

Related Questions

What is the condensed formula for benzene?

The condensed formula for benzene is C6H6.


What is the condensed formula for c2h4cl2?

The condensed formula for C2H4Cl2 is CH2Cl-CH2Cl.


What is the condensed formula for ethanol?

The chemical formula of ethanol is C2H5OH.


What is the condensed structural formula for N Methylaniline?

The condensed structural formula for N-methylaniline is CH3C6H4NH2.


What is the condensed stuctural formula for ethanol?

The condensed structural formula for ethanol is CH3CH2OH.


What is the condensed structural formula for 22 dimethylbutane?

The condensed structural formula for 2,2-dimethylbutane is CH3C(CH3)2CH2CH3.


What is the condensed structural formula of pentyl acetate?

The condensed structural formula of pentyl acetate is CH3COO(CH2)4CH3.


What is the condensed structural formula for 4-decene?

The condensed structural formula for 4-decene is CH3(CH2)8CH=CH2.


What is the condensed structural formula for the compound, and can you indicate it in a single question?

What is the condensed structural formula for the compound, and can you indicate it in a single question?


What is the condensed molecular formula of methoxyethane?

The condensed molecular formula of methoxyethane(also known as ethyl methyl ether):methyl group -> -CH3methoxy group -> -OCH3ethyl group -> -CH2CH3Methoxy group + ethyl group = CH3- and -O- and -CH2CH3 the condensed molecular formula is: CH3OCH2CH3


What is the condensed structural formula of cyclohexane?

Cyclohexane which is a cycloalkanes, has a structural formula of C6H12. It may be written in a condensed form as (CH2)6.


What is the condensed structural formula for methyl acetate?

The condensed structural formula for methyl acetate is CH3COOCH3.