0
CH3CH2COOCH2CH3
CH3-CH2-COO-CH2-CH3
Wiki User
∙ 14y ago
Add your answer:
Earn +20 pts
What is the condensed formula for 3-ethyl-2-methylpentane?
The condensed formula of 3-ethylpentane (CH2CH3)2CHCH2CH3 . Added: Another more trivial name is tri-ethyl methane CH(CH2CH3)3.
Write condensed structures for 3-ethylhexane?
C8H18 this is condensed formula for 3-ethyl hexane but this formula has some other isomers. This particular isomer 3-ethyl hexane is CH3-CH2-CH(C2H5)-CH2-CH2-CH3.
What is the equation for producing ethyl propanoate from iodoethane?
Ch3ch2i + oh- → ch3ch2oh + i- ch2ch3oh + ch3ch2cooh → ch2ch3cooch2ch3 + h2
How do you prepare ethyl methyl ketone from calcium acetate?
. Arry out dry distillation of calcium acetate with calcium propanoate vaibhav khanolkar
What is c2 h5 oh?
Ethanol the substance called in general "alcohol"
What is the condensed molecular formula of methoxyethane?
The condensed molecular formula of methoxyethane(also known as ethyl methyl ether):methyl group -> -CH3methoxy group -> -OCH3ethyl group -> -CH2CH3Methoxy group + ethyl group = CH3- and -O- and -CH2CH3 the condensed molecular formula is: CH3OCH2CH3
What is the product formed between propanoic acid and ethanol?
ethyl propanoate
What is the condensed formula for 3-ethyl-2-methylpentane?
The condensed formula of 3-ethylpentane (CH2CH3)2CHCH2CH3 . Added: Another more trivial name is tri-ethyl methane CH(CH2CH3)3.
What is condensed formula for N-ethyl-N-ethanamide?
H3c-ch2-nh-ch2-ch3
Write condensed structures for 3-ethylhexane?
C8H18 this is condensed formula for 3-ethyl hexane but this formula has some other isomers. This particular isomer 3-ethyl hexane is CH3-CH2-CH(C2H5)-CH2-CH2-CH3.
What is the equation for producing ethyl propanoate from iodoethane?
Ch3ch2i + oh- → ch3ch2oh + i- ch2ch3oh + ch3ch2cooh → ch2ch3cooch2ch3 + h2
What is the condensed structural formula for 3 ethyl 2 5 dimethyloctane?
Ch3ch(ch3)ch(ch2ch3)ch2ch(ch3)ch2ch2ch3
What liquids are just neutral except from water?
all esters, e.g. benzyl benzoate, ethyl propanoate, any ester is neutral
How do you prepare ethyl methyl ketone from calcium acetate?
. Arry out dry distillation of calcium acetate with calcium propanoate vaibhav khanolkar
What ester forms when ethyl alcohol and formic acid react?
The products from the reaction of n-amyl alcohol and acetic acid are ethyl pentanoate (an ester) and water. CH3COOH + CH3CH2CH2CH2CH2OH ==> CH3COOCH2CH2CH2CH2CH3 + H2O acetic acid + n-amyl alcohol ==> ethyl propanoate + water
What is the structural formula for ethyl alcohol?
Ethyl alcohol - ethanol - is a pure alcohol that is volatile and flammable. It has the structural formula of C2H6O.
What is the formula of ethylalcohal?
Ethyl (grain) alcohol has the formula of C2H5OH.
