0
C8H18 this is condensed formula for 3-ethyl hexane but this formula has some other isomers. This particular isomer 3-ethyl hexane is CH3-CH2-CH(C2H5)-CH2-CH2-CH3.
Wiki User
∙ 14y ago
Add your answer:
Earn +20 pts
What is the condensed structure of a thiol?
RSH - condensed general formula of compound CH3SH - methyl thiol
What is polonium's condensed electron configuration?
The condensed electron configuration of polonium is [Xe] 6s^2 4f^14 5d^10 6p^4.
Which of the following is a change from a more condensed to a less condensed state of matter?
By "more condensed", do you mean "denser"? If so, the answer is "usually but not always". The most famous example of a substance where the solid form is less dense than the liquid form at the same temperature is water.
Is DNA condensed in g2 phase?
yes
Why must not the condensed water drip into the flask?
q
How do you write 3-pentanol in condensed form?
C3H8O1
Where chromosomes are present?
Chromosomes are thick,condensed, ribbon-like structures which are visible within the nucleus at the time of cell division. They are the condensed form of chromatin fibres which are present in the nucleoplasm of the nucleus.
What is the condensed structural formula of Aniline?
resoance can be defined as stability of various structures with respect toeach other.
Write about different network structures in use?
different network structures in use? is a network structure it is gu
What are the dark staining rod shaped structures that are composed of highly coiled chromatin and found in cells undergoing cell division called?
Condensed chromatin
What does condensed in the word condensed soup mean?
Condensed
Who invented condensed milk?
Marco Polo was the first person to write about a condensed milk like product made by the "Tartars" but there is some dispute if this was actually a type of cheese. Also many traditional Indian sweetmeats are made by condensing milk. However, the first documented occurrence of Condensed milk was in 1820 in France.
What structures make up chromosomes?
Gene is the functional unit of chromosome.
What are chromosomes and when can they be seen?
Chromosomes are thread like structures which are made up of DNA and proteins , they are present in nucleus of cells .They can be seen only when the cell is dividing .
What is the purpose of use different text structures?
so we can see what you write
Write down the name, line structure, and condensed structure of 3-10 carbon chain with double and triple bond?
2cartons
Draw the structures of ribose?
write structure of oxidation product of D-ribose?
