answersLogoWhite

0

C8H18 this is condensed formula for 3-ethyl hexane but this formula has some other isomers. This particular isomer 3-ethyl hexane is CH3-CH2-CH(C2H5)-CH2-CH2-CH3.

User Avatar

Wiki User

16y ago

What else can I help you with?

Related Questions

How do you write 3-pentanol in condensed form?

C3H8O1


What is the condensed structural formula of Aniline?

resoance can be defined as stability of various structures with respect toeach other.


Where chromosomes are present?

Chromosomes are thick,condensed, ribbon-like structures which are visible within the nucleus at the time of cell division. They are the condensed form of chromatin fibres which are present in the nucleoplasm of the nucleus.


How do you write the condensed structural formula for 14-diclorocyclohexane?

The condensed structural formula for 1,4-dichlorocyclohexane is: Cl-CH2-CH2-CH2-CH2-CH2-CH2-Cl.


How can one write a condensed structural formula?

To write a condensed structural formula, use a simplified way to represent the atoms and bonds in a molecule. Instead of showing all the atoms and bonds, only the essential parts are included. This helps to quickly and clearly show the structure of the molecule.


What does condensed in the word condensed soup mean?

Condensed


Who invented condensed milk?

Marco Polo was the first person to write about a condensed milk like product made by the "Tartars" but there is some dispute if this was actually a type of cheese. Also many traditional Indian sweetmeats are made by condensing milk. However, the first documented occurrence of Condensed milk was in 1820 in France.


Write about different network structures in use?

different network structures in use? is a network structure it is gu


What is the difference between condensed milk and sweetened condensed milk?

Condensed milk is milk that has had water removed, while sweetened condensed milk is condensed milk that has sugar added to it.


Write down the name, line structure, and condensed structure of 3-10 carbon chain with double and triple bond?

2cartons


What is the difference between sweetened condensed milk and condensed milk?

Sweetened condensed milk has added sugar, while condensed milk does not have added sugar.


What two rod structures contain the cell's DNA?

The two rod structures that contain the cell's DNA are chromosomes and chromatin. Chromosomes are highly condensed structures that contain the DNA during cell division, while chromatin is the relaxed form of DNA that is present in the nucleus during interphase.