0
What else can I help you with?
How can one write a condensed structural formula?
To write a condensed structural formula, use a simplified way to represent the atoms and bonds in a molecule. Instead of showing all the atoms and bonds, only the essential parts are included. This helps to quickly and clearly show the structure of the molecule.
Write condensed structures for 3-ethylhexane?
C8H18 this is condensed formula for 3-ethyl hexane but this formula has some other isomers. This particular isomer 3-ethyl hexane is CH3-CH2-CH(C2H5)-CH2-CH2-CH3.
Chemical formula for liquid ammonia?
Liquid ammonia can refer to: a) Ammonia dissolved in water solution, forming Ammonium hydroxide = NH4OH b) Ammonia condensed to its liquid state = NH3(L) [Write the L in lower case]
Write the chemical formula for calcium phosphide?
The chemical formula for calcium phosphide is Ca3P2.
How do you write calcium silicate in chemical formula?
The chemical formula for calcium silicate is CaSiO3.
How can one write a condensed structural formula?
To write a condensed structural formula, use a simplified way to represent the atoms and bonds in a molecule. Instead of showing all the atoms and bonds, only the essential parts are included. This helps to quickly and clearly show the structure of the molecule.
What is a quick way of showing the chemical composition in a compound?
draw a structural formula for organics, write a chemical formula (molecular formula or ionic formula) for simpler compounds.
What is a quick way of showing the chemical composition of a compound?
draw a structural formula for organics, write a chemical formula (molecular formula or ionic formula) for simpler compounds.
What is the structural formula for 5-heptyne?
Assuming that the questioner intended to write 5,5-dimethyl-2-heptyne, a semi-structural formula that can be written with the limited character set available is C2H5C(CH3)2CH2C=CCH3.
What is the structural formula for 5-dimethyl-2-heptyne?
Assuming that the questioner intended to write 5,5-dimethyl-2-heptyne, a semi-structural formula that can be written with the limited character set available is C2H5C(CH3)2CH2C=CCH3.
How do you write 3-pentanol in condensed form?
C3H8O1
Write condensed structures for 3-ethylhexane?
C8H18 this is condensed formula for 3-ethyl hexane but this formula has some other isomers. This particular isomer 3-ethyl hexane is CH3-CH2-CH(C2H5)-CH2-CH2-CH3.
What is the structural formula of hemoglobin?
C738 H1166 N812 O203 S2 Fe is the chemical formula for the majority of it. There are several different formulae for haemoglobin. The structural would probably take about a week to write out.
Chemical formula for liquid ammonia?
Liquid ammonia can refer to: a) Ammonia dissolved in water solution, forming Ammonium hydroxide = NH4OH b) Ammonia condensed to its liquid state = NH3(L) [Write the L in lower case]
Define the following write the units and formula?
define the following write the units and formula
Who invented condensed milk?
Marco Polo was the first person to write about a condensed milk like product made by the "Tartars" but there is some dispute if this was actually a type of cheese. Also many traditional Indian sweetmeats are made by condensing milk. However, the first documented occurrence of Condensed milk was in 1820 in France.
How do you write in a formula?
hfksjfhjf
