answersLogoWhite

0

The structural formula for ethyl butanoate is CH3CH2CH2COOCH2CH3.

User Avatar

AnswerBot

1y ago

What else can I help you with?

Related Questions

What is the structural formula of propyl butanoate?

The structural formula of propyl butanoate is CH3CH2CH2COOCH2CH3. It consists of a four-carbon butanoate chain with a propyl group attached to the third carbon atom.


What is the structural formula for ethyl alcohol?

Ethyl alcohol - ethanol - is a pure alcohol that is volatile and flammable. It has the structural formula of C2H6O.


What are the possible isomers for C4H8O2?

Possible isomers for C4H8O2 include two pairs of structural isomers: 1) butyl acetate and ethyl propanoate, and 2) methyl butanoate and diethyl ether. Each pair has different structural arrangements of atoms while having the same molecular formula.


Chemical formula for ethyl acetate?

Molecular formula is C2H5CH3COO . Structural formula is CH3COOCH2CH3 .


What is the chemical formula of ethyl ethanoic?

The structural formula is CH3COOCH2CH3


What is the chemical formula for methyl butanoate?

C5h10o2 (Wiki.answers forced me to make capitalization changes)


What is the structural formula of 2-ethyl hexane?

The structural formula of 2-ethyl hexane is CH3(CH2)3CH(CH3)CH2CH3. It consists of an ethyl group (C2H5) attached to the second carbon atom of a hexane chain.


What is the condensed structural formula for 3 ethyl 2 5 dimethyloctane?

The condensed structural formula for 3-ethyl-2,5-dimethyloctane is CH3CH(CH2CH3)CH(CH3)C(CH3)2CH2CH2CH3.


What are the structural isomers of ester C5 H10 O2?

The structural isomers of C5H10O2 ester are pentyl formate, pentyl acetate, and methyl butanoate. These molecules have the same molecular formula but different arrangements of atoms.


What is the chemical symbol for methyl butanoate?

The molecular formula for methyl butyrate, also known as methyl butanoate, is C5H10O2.


What is the structural formula chemical equation for ethyl ethanoate plus water?

CH3CH2OOCCH3 + H2O ===> CH3CH2OH + CH3COOH


What is the IUPAC name of CH3CH2COOCH3?

methyl butanoate