0
What else can I help you with?
Chemical formula for ethyl acetate?
Molecular formula is C2H5CH3COO . Structural formula is CH3COOCH2CH3 .
What is the chemical formula for ethyl alcohol?
The chemical formula for ethyl alcohol is C2H5OH.
Ethyl alcohol formula?
Commonly known as ethanol Formula: C2H5OH
What is the molecular formula for 1-ethyl 2 propylcyclobutane?
The molecular formula for 1-ethyl-2-propylcyclobutane is C11H22. It consists of 11 carbon atoms and 22 hydrogen atoms, with two branching alkyl groups (ethyl and propyl) attached to a cyclobutane ring.
What is the chemical formula c2h5br?
Many organic compounds have this chemical formula; see the link below for details and structures.
What is the condensed structural formula of 4ethyl 2 2dimethlyoctane?
CH3C(CH3)2CH2CH(CH2CH3)CH2CH2CH2CH3 Remember, whatever is in brackets is connected to the carbon before it.
What is the structural formula for ethyl butanoate?
The structural formula for ethyl butanoate is CH3CH2CH2COOCH2CH3.
What is the condensed formula for ethyl propanoate?
The condensed formula for ethyl propanoate is CH3CH2COOCH2CH3.
What is condensed formula for N-ethyl-N-ethanamide?
The condensed formula for N-ethyl-N-ethanamide is EtNHCH2CH3.
What is the structural formula for ethyl alcohol?
Ethyl alcohol - ethanol - is a pure alcohol that is volatile and flammable. It has the structural formula of C2H6O.
What is the condensed molecular formula of methoxyethane?
The condensed molecular formula of methoxyethane(also known as ethyl methyl ether):methyl group -> -CH3methoxy group -> -OCH3ethyl group -> -CH2CH3Methoxy group + ethyl group = CH3- and -O- and -CH2CH3 the condensed molecular formula is: CH3OCH2CH3
Chemical formula for ethyl acetate?
Molecular formula is C2H5CH3COO . Structural formula is CH3COOCH2CH3 .
What is the condensed formula for 3-ethyl-2-methylpentane?
The condensed formula of 3-ethylpentane (CH2CH3)2CHCH2CH3 . Added: Another more trivial name is tri-ethyl methane CH(CH2CH3)3.
What is the condensed structural formula fo 6 ethyl 2 methyl 4 propylnonane?
Almost impossible to answer by this simple text editor of Answers.com, but let me try: (You can leave the '-'sign of the main string out) H3C-CH(CH3)-CH2-CH(C3H7)-CH2-CH(C2H5)-CH2-CH2-CH3
What is the structural formula of 2-ethyl hexane?
The structural formula of 2-ethyl hexane is CH3(CH2)3CH(CH3)CH2CH3. It consists of an ethyl group (C2H5) attached to the second carbon atom of a hexane chain.
What is the structural formula chemical equation for ethyl ethanoate plus water?
CH3CH2OOCCH3 + H2O ===> CH3CH2OH + CH3COOH
Write condensed structures for 3-ethylhexane?
C8H18 this is condensed formula for 3-ethyl hexane but this formula has some other isomers. This particular isomer 3-ethyl hexane is CH3-CH2-CH(C2H5)-CH2-CH2-CH3.
