0

Subjects>Science>Natural Sciences

What is the condensed structural formula fo 6 ethyl 2 methyl 4 propylnonane?

Anonymous

∙ 15y ago

Updated: 6/5/2024

Almost impossible to answer by this simple text editor of Answers.com, but let me try:

(You can leave the '-'sign of the main string out)

H3C-CH(CH3)-CH2-CH(C3H7)-CH2-CH(C2H5)-CH2-CH2-CH3

Wiki User

∙ 15y ago

What else can I help you with?

Continue Learning about Natural Sciences

What is the condensed structural formula for N-Methylaniline?

The condensed structural formula for N-methylaniline is C7H9N, where the nitrogen atom is attached to a methyl group (-CH3) and a phenyl group (-C6H5) on the benzene ring.

What is the condensed molecular formula of methoxyethane?

The condensed molecular formula of methoxyethane(also known as ethyl methyl ether):methyl group -> -CH3methoxy group -> -OCH3ethyl group -> -CH2CH3Methoxy group + ethyl group = CH3- and -O- and -CH2CH3 the condensed molecular formula is: CH3OCH2CH3

Condense structural formula of methyl pentanoate?

The structural formula of methyl pentanoate is CH3CH2CH2CH2COOCH3.

What is the structural formula of methyl methacrylate?

H2C=C(CH3)COOCH3

What is the structural formula of c3h7cooh ch3oh-c3h7cooch3 hoh?

The structural formula of C3H7COOH is CH3CH2COOH (propionic acid). The structural formula of CH3OH-C3H7COOCH3 is CH3OH + CH3CH2COOCH3 (methyl propionate). H2O (water) is produced when these two compounds react together.

Related Questions

What is the condensed structural formula for methyl acetate?

The condensed structural formula for methyl acetate is CH3COOCH3.

Condensed structural formula of methyl propyl ether?

The condensed structural formula of methyl propyl ether is CH3OCH2CH2CH3.

What is the condensed structural formula for N-Methylaniline?

The condensed structural formula for N-methylaniline is C7H9N, where the nitrogen atom is attached to a methyl group (-CH3) and a phenyl group (-C6H5) on the benzene ring.

What is the Structural formula for 3-methyl-1-butene?

structural formula of c5h10

What is the condensed molecular formula of methoxyethane?

The condensed molecular formula of methoxyethane(also known as ethyl methyl ether):methyl group -> -CH3methoxy group -> -OCH3ethyl group -> -CH2CH3Methoxy group + ethyl group = CH3- and -O- and -CH2CH3 the condensed molecular formula is: CH3OCH2CH3

Condense structural formula of methyl pentanoate?

The structural formula of methyl pentanoate is CH3CH2CH2CH2COOCH3.

Structural formula of 3-chloro 2-methyl 1-butanol?

A structural formula diagram of 3-chloro-2-methyl-1-butanol would include HO with a line drawn from it. Attached to the line would be offshoots which represented the methyl and butanol.

What is the structural formula for methyl group?

The structural formula for a methyl group is CH3. It consists of one carbon atom bonded to three hydrogen atoms.

What is the structural formula of methyl methacrylate?

H2C=C(CH3)COOCH3

What is the structural formula of c3h7cooh ch3oh-c3h7cooch3 hoh?

The structural formula of C3H7COOH is CH3CH2COOH (propionic acid). The structural formula of CH3OH-C3H7COOCH3 is CH3OH + CH3CH2COOCH3 (methyl propionate). H2O (water) is produced when these two compounds react together.

Structural formula for p-xylene?

The structural formula for p-xylene is C8H10. It consists of a benzene ring with a methyl group attached to the fourth carbon atom.

What is the chemical formula for 2-methyl-2hexene?

A semi-structural formula for this molecule is CH3-(CH2)2-CH=C(CH3)-CH3.

Trending Questions

What block is Si in on the periodic table? What is the property called when one gas mixes with another gas easily? Why mercury's year is shorter than Neptune's? Where in a chloroplasts do the light reactions of photosynthesis take place? How many decimeters equals 3 centimeters? Can you stop the world from ending? What is waterfront? Why is lycoperdon gemmatum fungus? How does an enzyme speed up reactions? Are proteins organic? How many significant figures are there in 7.2500? What if your bowling ball weighs 14 pounds. How much does it weigh in ounces? Did Amerigo Vespucci travel Hispaniola? What makes the blood flow through the blood tubes? What is the weight of a one-hundred-foot column of water that is four inches in diameter? What was Sarnia's coldest day? Is it true that if you get a mood ring wet it will never work again? What is an example of IPDE? What are organisms that derive their chemical energy from the process of chemosynthesis? What are some liquid mechanical mixtures?

Resources

Top Categories

Product

Company

Copyright ©2025 Answers.com. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.